About 2-cyclobutyl-4-methoxy-3-methylpyridine;2,6-dimethoxy-3-methylpyridine
2-cyclobutyl-4-methoxy-3-methylpyridine;2,6-dimethoxy-3-methylpyridine (PubChem CID 177181281) has the molecular formula C19H26N2O3
and a molecular weight of 330.43 g/mol. Its IUPAC name is 2-cyclobutyl-4-methoxy-3-methylpyridine;2,6-dimethoxy-3-methylpyridine.
Molecular Properties
| Compound Name | 2-cyclobutyl-4-methoxy-3-methylpyridine;2,6-dimethoxy-3-methylpyridine |
| PubChem CID | 177181281 |
| Molecular Formula | C19H26N2O3 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | 2-cyclobutyl-4-methoxy-3-methylpyridine;2,6-dimethoxy-3-methylpyridine |
| SMILES | COc1ccc(C)c(OC)n1.COc1ccnc(C2CCC2)c1C |
| InChI | InChI=1S/C11H15NO.C8H11NO2/c1-8-10(13-2)6-7-12-11(8)9-4-3-5-9;1-6-4-5-7(10-2)9-8(6)11-3/h6-7,9H,3-5H2,1-2H3;4-5H,1-3H3 |
| InChIKey | GWMJMJNCXJESDE-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 53.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-cyclobutyl-4-methoxy-3-methylpyridine;2,6-dimethoxy-3-methylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclobutyl-4-methoxy-3-methylpyridine;2,6-dimethoxy-3-methylpyridine?
The IUPAC name of 2-cyclobutyl-4-methoxy-3-methylpyridine;2,6-dimethoxy-3-methylpyridine (CID 177181281) is 2-cyclobutyl-4-methoxy-3-methylpyridine;2,6-dimethoxy-3-methylpyridine.
What is the SMILES notation for 2-cyclobutyl-4-methoxy-3-methylpyridine;2,6-dimethoxy-3-methylpyridine?
The canonical SMILES for 2-cyclobutyl-4-methoxy-3-methylpyridine;2,6-dimethoxy-3-methylpyridine is COc1ccc(C)c(OC)n1.COc1ccnc(C2CCC2)c1C.
What is the InChIKey of 2-cyclobutyl-4-methoxy-3-methylpyridine;2,6-dimethoxy-3-methylpyridine?
The InChIKey is GWMJMJNCXJESDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO.C8H11NO2/c1-8-10(13-2)6-7-12-11(8)9-4-3-5-9;1-6-4-5-7(10-2)9-8(6)11-3/h6-7,9H,3-5H2,1-2H3;4-5H,1-3H3.
What are the key properties of 2-cyclobutyl-4-methoxy-3-methylpyridine;2,6-dimethoxy-3-methylpyridine?
2-cyclobutyl-4-methoxy-3-methylpyridine;2,6-dimethoxy-3-methylpyridine has a molecular weight of 330.43 g/mol, XLogP of 4.07, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclobutyl-4-methoxy-3-methylpyridine;2,6-dimethoxy-3-methylpyridine is sourced from PubChem (CID 177181281), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).