C8H6Br2ClNO — CID 177181982
N-(2,6-dibromophenyl)-N-methylcarbamoyl chloride (PubChem CID 177181982) has the molecular formula C8H6Br2ClNO and a molecular weight of 327.40 g/mol. Its IUPAC name is N-(2,6-dibromophenyl)-N-methylcarbamoyl chloride.
| Compound Name | N-(2,6-dibromophenyl)-N-methylcarbamoyl chloride |
|---|---|
| PubChem CID | 177181982 |
| Molecular Formula | C8H6Br2ClNO |
| Molecular Weight | 327.40 g/mol |
| Exact Mass | 324.85 |
| IUPAC Name | N-(2,6-dibromophenyl)-N-methylcarbamoyl chloride |
| SMILES | CN(C(=O)Cl)c1c(Br)cccc1Br |
| InChI | InChI=1S/C8H6Br2ClNO/c1-12(8(11)13)7-5(9)3-2-4-6(7)10/h2-4H,1H3 |
| InChIKey | XHEZFLPZWMSARJ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.40 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|