C39H33F2N5O2 — CID 177182000
(2S,3S)-3-[[5-fluoro-2-(5-fluoro-1-tritylpyrrolo[2,3-b]pyridin-3-yl)pyrimidin-4-yl]amino]bicyclo[2.2.2]octane-2-carboxylic acid (PubChem CID 177182000) has the molecular formula C39H33F2N5O2 and a molecular weight of 641.72 g/mol. Its IUPAC name is (2S,3S)-3-[[5-fluoro-2-(5-fluoro-1-tritylpyrrolo[2,3-b]pyridin-3-yl)pyrimidin-4-yl]amino]bicyclo[2.2.2]octane-2-carboxylic acid.
| Compound Name | (2S,3S)-3-[[5-fluoro-2-(5-fluoro-1-tritylpyrrolo[2,3-b]pyridin-3-yl)pyrimidin-4-yl]amino]bicyclo[2.2.2]octane-2-carboxylic acid |
|---|---|
| PubChem CID | 177182000 |
| Molecular Formula | C39H33F2N5O2 |
| Molecular Weight | 641.72 g/mol |
| Exact Mass | 641.26 |
| IUPAC Name | (2S,3S)-3-[[5-fluoro-2-(5-fluoro-1-tritylpyrrolo[2,3-b]pyridin-3-yl)pyrimidin-4-yl]amino]bicyclo[2.2.2]octane-2-carboxylic acid |
| SMILES | O=C(O)[C@H]1C2CCC(CC2)[C@@H]1Nc1nc(-c2cn(C(c3ccccc3)(c3ccccc3)c3ccccc3)c3ncc(F)cc23)ncc1F |
| InChI | InChI=1S/C39H33F2N5O2/c40-29-20-30-31(35-42-22-32(41)36(45-35)44-34-25-18-16-24(17-19-25)33(34)38(47)48)23-46(37(30)43-21-29)39(26-10-4-1-5-11-26,27-12-6-2-7-13-27)28-14-8-3-9-15-28/h1-15,20-25,33-34H,16-19H2,(H,47,48)(H,42,44,45)/t24?,25?,33-,34-/m0/s1 |
| InChIKey | BMKCUFAAGVBKOG-JQUXOEHGSA-N |
| XLogP | 7.91 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.72 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|