C20H37NO3 — CID 177182632
2-nonyl-3-octanoyl-1,3-oxazolidin-5-one (PubChem CID 177182632) has the molecular formula C20H37NO3 and a molecular weight of 339.52 g/mol. Its IUPAC name is 2-nonyl-3-octanoyl-1,3-oxazolidin-5-one.
| Compound Name | 2-nonyl-3-octanoyl-1,3-oxazolidin-5-one |
|---|---|
| PubChem CID | 177182632 |
| Molecular Formula | C20H37NO3 |
| Molecular Weight | 339.52 g/mol |
| Exact Mass | 339.28 |
| IUPAC Name | 2-nonyl-3-octanoyl-1,3-oxazolidin-5-one |
| SMILES | CCCCCCCCCC1OC(=O)CN1C(=O)CCCCCCC |
| InChI | InChI=1S/C20H37NO3/c1-3-5-7-9-10-12-14-16-19-21(17-20(23)24-19)18(22)15-13-11-8-6-4-2/h19H,3-17H2,1-2H3 |
| InChIKey | RKTBJHOOYUWWIN-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.52 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|