About (3R)-N-(2-fluoroethyl)-3,4-dimethylcyclohexan-1-amine
(3R)-N-(2-fluoroethyl)-3,4-dimethylcyclohexan-1-amine (PubChem CID 177182717) has the molecular formula C10H20FN
and a molecular weight of 173.27 g/mol. Its IUPAC name is (3R)-N-(2-fluoroethyl)-3,4-dimethylcyclohexan-1-amine.
Molecular Properties
| Compound Name | (3R)-N-(2-fluoroethyl)-3,4-dimethylcyclohexan-1-amine |
| PubChem CID | 177182717 |
| Molecular Formula | C10H20FN |
| Molecular Weight | 173.27 g/mol |
| Exact Mass | 173.16 |
| IUPAC Name | (3R)-N-(2-fluoroethyl)-3,4-dimethylcyclohexan-1-amine |
| SMILES | CC1CCC(NCCF)C[C@H]1C |
| InChI | InChI=1S/C10H20FN/c1-8-3-4-10(7-9(8)2)12-6-5-11/h8-10,12H,3-7H2,1-2H3/t8?,9-,10?/m1/s1 |
| InChIKey | GBKRIBRIWSVPIA-HWOCKDDLSA-N |
| XLogP | 2.37 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.27 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (3R)-N-(2-fluoroethyl)-3,4-dimethylcyclohexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-N-(2-fluoroethyl)-3,4-dimethylcyclohexan-1-amine?
The IUPAC name of (3R)-N-(2-fluoroethyl)-3,4-dimethylcyclohexan-1-amine (CID 177182717) is (3R)-N-(2-fluoroethyl)-3,4-dimethylcyclohexan-1-amine.
What is the SMILES notation for (3R)-N-(2-fluoroethyl)-3,4-dimethylcyclohexan-1-amine?
The canonical SMILES for (3R)-N-(2-fluoroethyl)-3,4-dimethylcyclohexan-1-amine is CC1CCC(NCCF)C[C@H]1C.
What is the InChIKey of (3R)-N-(2-fluoroethyl)-3,4-dimethylcyclohexan-1-amine?
The InChIKey is GBKRIBRIWSVPIA-HWOCKDDLSA-N. The full InChI is InChI=1S/C10H20FN/c1-8-3-4-10(7-9(8)2)12-6-5-11/h8-10,12H,3-7H2,1-2H3/t8?,9-,10?/m1/s1.
What are the key properties of (3R)-N-(2-fluoroethyl)-3,4-dimethylcyclohexan-1-amine?
(3R)-N-(2-fluoroethyl)-3,4-dimethylcyclohexan-1-amine has a molecular weight of 173.27 g/mol, XLogP of 2.37, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-N-(2-fluoroethyl)-3,4-dimethylcyclohexan-1-amine is sourced from PubChem (CID 177182717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).