About 3-[(3,3-difluorocyclopentanecarbonyl)amino]propanoic acid;methane
3-[(3,3-difluorocyclopentanecarbonyl)amino]propanoic acid;methane (PubChem CID 177183461) has the molecular formula C10H17F2NO3
and a molecular weight of 237.25 g/mol. Its IUPAC name is 3-[(3,3-difluorocyclopentanecarbonyl)amino]propanoic acid;methane.
Molecular Properties
| Compound Name | 3-[(3,3-difluorocyclopentanecarbonyl)amino]propanoic acid;methane |
| PubChem CID | 177183461 |
| Molecular Formula | C10H17F2NO3 |
| Molecular Weight | 237.25 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | 3-[(3,3-difluorocyclopentanecarbonyl)amino]propanoic acid;methane |
| SMILES | C.O=C(O)CCNC(=O)C1CCC(F)(F)C1 |
| InChI | InChI=1S/C9H13F2NO3.CH4/c10-9(11)3-1-6(5-9)8(15)12-4-2-7(13)14;/h6H,1-5H2,(H,12,15)(H,13,14);1H4 |
| InChIKey | MCWLOGZLPQXXRZ-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.25 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-[(3,3-difluorocyclopentanecarbonyl)amino]propanoic acid;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3,3-difluorocyclopentanecarbonyl)amino]propanoic acid;methane?
The IUPAC name of 3-[(3,3-difluorocyclopentanecarbonyl)amino]propanoic acid;methane (CID 177183461) is 3-[(3,3-difluorocyclopentanecarbonyl)amino]propanoic acid;methane.
What is the SMILES notation for 3-[(3,3-difluorocyclopentanecarbonyl)amino]propanoic acid;methane?
The canonical SMILES for 3-[(3,3-difluorocyclopentanecarbonyl)amino]propanoic acid;methane is C.O=C(O)CCNC(=O)C1CCC(F)(F)C1.
What is the InChIKey of 3-[(3,3-difluorocyclopentanecarbonyl)amino]propanoic acid;methane?
The InChIKey is MCWLOGZLPQXXRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13F2NO3.CH4/c10-9(11)3-1-6(5-9)8(15)12-4-2-7(13)14;/h6H,1-5H2,(H,12,15)(H,13,14);1H4.
What are the key properties of 3-[(3,3-difluorocyclopentanecarbonyl)amino]propanoic acid;methane?
3-[(3,3-difluorocyclopentanecarbonyl)amino]propanoic acid;methane has a molecular weight of 237.25 g/mol, XLogP of 1.65, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3,3-difluorocyclopentanecarbonyl)amino]propanoic acid;methane is sourced from PubChem (CID 177183461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).