About [5-(3-methylphenyl)-1,3-dioxoisoindol-2-yl] morpholine-4-carboxylate
[5-(3-methylphenyl)-1,3-dioxoisoindol-2-yl] morpholine-4-carboxylate (PubChem CID 177183635) has the molecular formula C20H18N2O5
and a molecular weight of 366.37 g/mol. Its IUPAC name is [5-(3-methylphenyl)-1,3-dioxoisoindol-2-yl] morpholine-4-carboxylate.
Molecular Properties
| Compound Name | [5-(3-methylphenyl)-1,3-dioxoisoindol-2-yl] morpholine-4-carboxylate |
| PubChem CID | 177183635 |
| Molecular Formula | C20H18N2O5 |
| Molecular Weight | 366.37 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | [5-(3-methylphenyl)-1,3-dioxoisoindol-2-yl] morpholine-4-carboxylate |
| SMILES | Cc1cccc(-c2ccc3c(c2)C(=O)N(OC(=O)N2CCOCC2)C3=O)c1 |
| InChI | InChI=1S/C20H18N2O5/c1-13-3-2-4-14(11-13)15-5-6-16-17(12-15)19(24)22(18(16)23)27-20(25)21-7-9-26-10-8-21/h2-6,11-12H,7-10H2,1H3 |
| InChIKey | OKWYOKAKCRRBFV-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.37 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze [5-(3-methylphenyl)-1,3-dioxoisoindol-2-yl] morpholine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(3-methylphenyl)-1,3-dioxoisoindol-2-yl] morpholine-4-carboxylate?
The IUPAC name of [5-(3-methylphenyl)-1,3-dioxoisoindol-2-yl] morpholine-4-carboxylate (CID 177183635) is [5-(3-methylphenyl)-1,3-dioxoisoindol-2-yl] morpholine-4-carboxylate.
What is the SMILES notation for [5-(3-methylphenyl)-1,3-dioxoisoindol-2-yl] morpholine-4-carboxylate?
The canonical SMILES for [5-(3-methylphenyl)-1,3-dioxoisoindol-2-yl] morpholine-4-carboxylate is Cc1cccc(-c2ccc3c(c2)C(=O)N(OC(=O)N2CCOCC2)C3=O)c1.
What is the InChIKey of [5-(3-methylphenyl)-1,3-dioxoisoindol-2-yl] morpholine-4-carboxylate?
The InChIKey is OKWYOKAKCRRBFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18N2O5/c1-13-3-2-4-14(11-13)15-5-6-16-17(12-15)19(24)22(18(16)23)27-20(25)21-7-9-26-10-8-21/h2-6,11-12H,7-10H2,1H3.
What are the key properties of [5-(3-methylphenyl)-1,3-dioxoisoindol-2-yl] morpholine-4-carboxylate?
[5-(3-methylphenyl)-1,3-dioxoisoindol-2-yl] morpholine-4-carboxylate has a molecular weight of 366.37 g/mol, XLogP of 2.64, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(3-methylphenyl)-1,3-dioxoisoindol-2-yl] morpholine-4-carboxylate is sourced from PubChem (CID 177183635), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).