About 1-[4-(5-formylpyrrolo[2,3-b]pyridin-1-yl)phenyl]cyclopropane-1-carboxylic acid
1-[4-(5-formylpyrrolo[2,3-b]pyridin-1-yl)phenyl]cyclopropane-1-carboxylic acid (PubChem CID 177185591) has the molecular formula C18H14N2O3
and a molecular weight of 306.32 g/mol. Its IUPAC name is 1-[4-(5-formylpyrrolo[2,3-b]pyridin-1-yl)phenyl]cyclopropane-1-carboxylic acid.
Molecular Properties
| Compound Name | 1-[4-(5-formylpyrrolo[2,3-b]pyridin-1-yl)phenyl]cyclopropane-1-carboxylic acid |
| PubChem CID | 177185591 |
| Molecular Formula | C18H14N2O3 |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | 1-[4-(5-formylpyrrolo[2,3-b]pyridin-1-yl)phenyl]cyclopropane-1-carboxylic acid |
| SMILES | O=Cc1cnc2c(ccn2-c2ccc(C3(C(=O)O)CC3)cc2)c1 |
| InChI | InChI=1S/C18H14N2O3/c21-11-12-9-13-5-8-20(16(13)19-10-12)15-3-1-14(2-4-15)18(6-7-18)17(22)23/h1-5,8-11H,6-7H2,(H,22,23) |
| InChIKey | JJJBPTKBVQIMRT-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 1-[4-(5-formylpyrrolo[2,3-b]pyridin-1-yl)phenyl]cyclopropane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(5-formylpyrrolo[2,3-b]pyridin-1-yl)phenyl]cyclopropane-1-carboxylic acid?
The IUPAC name of 1-[4-(5-formylpyrrolo[2,3-b]pyridin-1-yl)phenyl]cyclopropane-1-carboxylic acid (CID 177185591) is 1-[4-(5-formylpyrrolo[2,3-b]pyridin-1-yl)phenyl]cyclopropane-1-carboxylic acid.
What is the SMILES notation for 1-[4-(5-formylpyrrolo[2,3-b]pyridin-1-yl)phenyl]cyclopropane-1-carboxylic acid?
The canonical SMILES for 1-[4-(5-formylpyrrolo[2,3-b]pyridin-1-yl)phenyl]cyclopropane-1-carboxylic acid is O=Cc1cnc2c(ccn2-c2ccc(C3(C(=O)O)CC3)cc2)c1.
What is the InChIKey of 1-[4-(5-formylpyrrolo[2,3-b]pyridin-1-yl)phenyl]cyclopropane-1-carboxylic acid?
The InChIKey is JJJBPTKBVQIMRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14N2O3/c21-11-12-9-13-5-8-20(16(13)19-10-12)15-3-1-14(2-4-15)18(6-7-18)17(22)23/h1-5,8-11H,6-7H2,(H,22,23).
What are the key properties of 1-[4-(5-formylpyrrolo[2,3-b]pyridin-1-yl)phenyl]cyclopropane-1-carboxylic acid?
1-[4-(5-formylpyrrolo[2,3-b]pyridin-1-yl)phenyl]cyclopropane-1-carboxylic acid has a molecular weight of 306.32 g/mol, XLogP of 2.95, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(5-formylpyrrolo[2,3-b]pyridin-1-yl)phenyl]cyclopropane-1-carboxylic acid is sourced from PubChem (CID 177185591), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).