C15H19F3N2O — CID 177186551
(2E,4Z)-1-(4-methylpiperazin-1-yl)-4-(3,3,3-trifluoroprop-1-en-2-yl)hepta-2,4,6-trien-1-one (PubChem CID 177186551) has the molecular formula C15H19F3N2O and a molecular weight of 300.32 g/mol. Its IUPAC name is (2E,4Z)-1-(4-methylpiperazin-1-yl)-4-(3,3,3-trifluoroprop-1-en-2-yl)hepta-2,4,6-trien-1-one.
| Compound Name | (2E,4Z)-1-(4-methylpiperazin-1-yl)-4-(3,3,3-trifluoroprop-1-en-2-yl)hepta-2,4,6-trien-1-one |
|---|---|
| PubChem CID | 177186551 |
| Molecular Formula | C15H19F3N2O |
| Molecular Weight | 300.32 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | (2E,4Z)-1-(4-methylpiperazin-1-yl)-4-(3,3,3-trifluoroprop-1-en-2-yl)hepta-2,4,6-trien-1-one |
| SMILES | C=C/C=C(/C=C/C(=O)N1CCN(C)CC1)C(=C)C(F)(F)F |
| InChI | InChI=1S/C15H19F3N2O/c1-4-5-13(12(2)15(16,17)18)6-7-14(21)20-10-8-19(3)9-11-20/h4-7H,1-2,8-11H2,3H3/b7-6+,13-5- |
| InChIKey | IGJDXCFTMPGLCC-HLJJKZETSA-N |
| XLogP | 2.55 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.32 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|