About CID 177186573
CID 177186573 (PubChem CID 177186573) has the molecular formula C5H7BN
and a molecular weight of 91.93 g/mol.
Molecular Properties
| Compound Name | CID 177186573 |
| PubChem CID | 177186573 |
| Molecular Formula | C5H7BN |
| Molecular Weight | 91.93 g/mol |
| Exact Mass | 92.07 |
| IUPAC Name | — |
| SMILES | CC1=C(C)N=C[B]1 |
| InChI | InChI=1S/C5H7BN/c1-4-5(2)7-3-6-4/h3H,1-2H3 |
| InChIKey | KEADRRDQJAYXHB-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 91.93 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 177186573 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 177186573?
The IUPAC name of CID 177186573 (CID 177186573) is not available.
What is the SMILES notation for CID 177186573?
The canonical SMILES for CID 177186573 is CC1=C(C)N=C[B]1.
What is the InChIKey of CID 177186573?
The InChIKey is KEADRRDQJAYXHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7BN/c1-4-5(2)7-3-6-4/h3H,1-2H3.
What are the key properties of CID 177186573?
CID 177186573 has a molecular weight of 91.93 g/mol, XLogP of 0.98, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 177186573 is sourced from PubChem (CID 177186573), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).