About 2-(2,2-difluoroethyl)-5-oxa-2,8-diazaspiro[3.5]nonane
2-(2,2-difluoroethyl)-5-oxa-2,8-diazaspiro[3.5]nonane (PubChem CID 177186675) has the molecular formula C8H14F2N2O
and a molecular weight of 192.21 g/mol. Its IUPAC name is 2-(2,2-difluoroethyl)-5-oxa-2,8-diazaspiro[3.5]nonane.
Molecular Properties
| Compound Name | 2-(2,2-difluoroethyl)-5-oxa-2,8-diazaspiro[3.5]nonane |
| PubChem CID | 177186675 |
| Molecular Formula | C8H14F2N2O |
| Molecular Weight | 192.21 g/mol |
| Exact Mass | 192.11 |
| IUPAC Name | 2-(2,2-difluoroethyl)-5-oxa-2,8-diazaspiro[3.5]nonane |
| SMILES | FC(F)CN1CC2(CNCCO2)C1 |
| InChI | InChI=1S/C8H14F2N2O/c9-7(10)3-12-5-8(6-12)4-11-1-2-13-8/h7,11H,1-6H2 |
| InChIKey | AMOXBILMVATVGQ-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.21 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(2,2-difluoroethyl)-5-oxa-2,8-diazaspiro[3.5]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,2-difluoroethyl)-5-oxa-2,8-diazaspiro[3.5]nonane?
The IUPAC name of 2-(2,2-difluoroethyl)-5-oxa-2,8-diazaspiro[3.5]nonane (CID 177186675) is 2-(2,2-difluoroethyl)-5-oxa-2,8-diazaspiro[3.5]nonane.
What is the SMILES notation for 2-(2,2-difluoroethyl)-5-oxa-2,8-diazaspiro[3.5]nonane?
The canonical SMILES for 2-(2,2-difluoroethyl)-5-oxa-2,8-diazaspiro[3.5]nonane is FC(F)CN1CC2(CNCCO2)C1.
What is the InChIKey of 2-(2,2-difluoroethyl)-5-oxa-2,8-diazaspiro[3.5]nonane?
The InChIKey is AMOXBILMVATVGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14F2N2O/c9-7(10)3-12-5-8(6-12)4-11-1-2-13-8/h7,11H,1-6H2.
What are the key properties of 2-(2,2-difluoroethyl)-5-oxa-2,8-diazaspiro[3.5]nonane?
2-(2,2-difluoroethyl)-5-oxa-2,8-diazaspiro[3.5]nonane has a molecular weight of 192.21 g/mol, XLogP of -0.07, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,2-difluoroethyl)-5-oxa-2,8-diazaspiro[3.5]nonane is sourced from PubChem (CID 177186675), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).