About 1-[2-(6-chloro-1-methyl-2,7-naphthyridin-4-yl)-1,3-benzoxazol-5-yl]cyclobutan-1-ol
1-[2-(6-chloro-1-methyl-2,7-naphthyridin-4-yl)-1,3-benzoxazol-5-yl]cyclobutan-1-ol (PubChem CID 177187081) has the molecular formula C20H16ClN3O2
and a molecular weight of 365.82 g/mol. Its IUPAC name is 1-[2-(6-chloro-1-methyl-2,7-naphthyridin-4-yl)-1,3-benzoxazol-5-yl]cyclobutan-1-ol.
Molecular Properties
| Compound Name | 1-[2-(6-chloro-1-methyl-2,7-naphthyridin-4-yl)-1,3-benzoxazol-5-yl]cyclobutan-1-ol |
| PubChem CID | 177187081 |
| Molecular Formula | C20H16ClN3O2 |
| Molecular Weight | 365.82 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | 1-[2-(6-chloro-1-methyl-2,7-naphthyridin-4-yl)-1,3-benzoxazol-5-yl]cyclobutan-1-ol |
| SMILES | Cc1ncc(-c2nc3cc(C4(O)CCC4)ccc3o2)c2cc(Cl)ncc12 |
| InChI | InChI=1S/C20H16ClN3O2/c1-11-14-9-23-18(21)8-13(14)15(10-22-11)19-24-16-7-12(3-4-17(16)26-19)20(25)5-2-6-20/h3-4,7-10,25H,2,5-6H2,1H3 |
| InChIKey | RTQGPRRVMMRFJY-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 72.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.82 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 1-[2-(6-chloro-1-methyl-2,7-naphthyridin-4-yl)-1,3-benzoxazol-5-yl]cyclobutan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(6-chloro-1-methyl-2,7-naphthyridin-4-yl)-1,3-benzoxazol-5-yl]cyclobutan-1-ol?
The IUPAC name of 1-[2-(6-chloro-1-methyl-2,7-naphthyridin-4-yl)-1,3-benzoxazol-5-yl]cyclobutan-1-ol (CID 177187081) is 1-[2-(6-chloro-1-methyl-2,7-naphthyridin-4-yl)-1,3-benzoxazol-5-yl]cyclobutan-1-ol.
What is the SMILES notation for 1-[2-(6-chloro-1-methyl-2,7-naphthyridin-4-yl)-1,3-benzoxazol-5-yl]cyclobutan-1-ol?
The canonical SMILES for 1-[2-(6-chloro-1-methyl-2,7-naphthyridin-4-yl)-1,3-benzoxazol-5-yl]cyclobutan-1-ol is Cc1ncc(-c2nc3cc(C4(O)CCC4)ccc3o2)c2cc(Cl)ncc12.
What is the InChIKey of 1-[2-(6-chloro-1-methyl-2,7-naphthyridin-4-yl)-1,3-benzoxazol-5-yl]cyclobutan-1-ol?
The InChIKey is RTQGPRRVMMRFJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16ClN3O2/c1-11-14-9-23-18(21)8-13(14)15(10-22-11)19-24-16-7-12(3-4-17(16)26-19)20(25)5-2-6-20/h3-4,7-10,25H,2,5-6H2,1H3.
What are the key properties of 1-[2-(6-chloro-1-methyl-2,7-naphthyridin-4-yl)-1,3-benzoxazol-5-yl]cyclobutan-1-ol?
1-[2-(6-chloro-1-methyl-2,7-naphthyridin-4-yl)-1,3-benzoxazol-5-yl]cyclobutan-1-ol has a molecular weight of 365.82 g/mol, XLogP of 4.77, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(6-chloro-1-methyl-2,7-naphthyridin-4-yl)-1,3-benzoxazol-5-yl]cyclobutan-1-ol is sourced from PubChem (CID 177187081), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).