About ethane;(2E)-2-(3-methoxy-2,3-dihydroinden-1-ylidene)acetaldehyde
ethane;(2E)-2-(3-methoxy-2,3-dihydroinden-1-ylidene)acetaldehyde (PubChem CID 177187500) has the molecular formula C14H18O2
and a molecular weight of 218.30 g/mol. Its IUPAC name is ethane;(2E)-2-(3-methoxy-2,3-dihydroinden-1-ylidene)acetaldehyde.
Molecular Properties
| Compound Name | ethane;(2E)-2-(3-methoxy-2,3-dihydroinden-1-ylidene)acetaldehyde |
| PubChem CID | 177187500 |
| Molecular Formula | C14H18O2 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | ethane;(2E)-2-(3-methoxy-2,3-dihydroinden-1-ylidene)acetaldehyde |
| SMILES | CC.COC1C/C(=C\C=O)c2ccccc21 |
| InChI | InChI=1S/C12H12O2.C2H6/c1-14-12-8-9(6-7-13)10-4-2-3-5-11(10)12;1-2/h2-7,12H,8H2,1H3;1-2H3/b9-6+; |
| InChIKey | JHAMGTIEPVKXLB-MLBSPLJJSA-N |
| XLogP | 3.39 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethane;(2E)-2-(3-methoxy-2,3-dihydroinden-1-ylidene)acetaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(2E)-2-(3-methoxy-2,3-dihydroinden-1-ylidene)acetaldehyde?
The IUPAC name of ethane;(2E)-2-(3-methoxy-2,3-dihydroinden-1-ylidene)acetaldehyde (CID 177187500) is ethane;(2E)-2-(3-methoxy-2,3-dihydroinden-1-ylidene)acetaldehyde.
What is the SMILES notation for ethane;(2E)-2-(3-methoxy-2,3-dihydroinden-1-ylidene)acetaldehyde?
The canonical SMILES for ethane;(2E)-2-(3-methoxy-2,3-dihydroinden-1-ylidene)acetaldehyde is CC.COC1C/C(=C\C=O)c2ccccc21.
What is the InChIKey of ethane;(2E)-2-(3-methoxy-2,3-dihydroinden-1-ylidene)acetaldehyde?
The InChIKey is JHAMGTIEPVKXLB-MLBSPLJJSA-N. The full InChI is InChI=1S/C12H12O2.C2H6/c1-14-12-8-9(6-7-13)10-4-2-3-5-11(10)12;1-2/h2-7,12H,8H2,1H3;1-2H3/b9-6+;.
What are the key properties of ethane;(2E)-2-(3-methoxy-2,3-dihydroinden-1-ylidene)acetaldehyde?
ethane;(2E)-2-(3-methoxy-2,3-dihydroinden-1-ylidene)acetaldehyde has a molecular weight of 218.30 g/mol, XLogP of 3.39, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(2E)-2-(3-methoxy-2,3-dihydroinden-1-ylidene)acetaldehyde is sourced from PubChem (CID 177187500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).