About N-[(2E)-2-(4,5-dihydrocyclopenta[b]thiophen-6-ylidene)ethyl]propan-2-amine
N-[(2E)-2-(4,5-dihydrocyclopenta[b]thiophen-6-ylidene)ethyl]propan-2-amine (PubChem CID 177187512) has the molecular formula C12H17NS
and a molecular weight of 207.34 g/mol. Its IUPAC name is N-[(2E)-2-(4,5-dihydrocyclopenta[b]thiophen-6-ylidene)ethyl]propan-2-amine.
Molecular Properties
| Compound Name | N-[(2E)-2-(4,5-dihydrocyclopenta[b]thiophen-6-ylidene)ethyl]propan-2-amine |
| PubChem CID | 177187512 |
| Molecular Formula | C12H17NS |
| Molecular Weight | 207.34 g/mol |
| Exact Mass | 207.11 |
| IUPAC Name | N-[(2E)-2-(4,5-dihydrocyclopenta[b]thiophen-6-ylidene)ethyl]propan-2-amine |
| SMILES | CC(C)NC/C=C1\CCc2ccsc21 |
| InChI | InChI=1S/C12H17NS/c1-9(2)13-7-5-10-3-4-11-6-8-14-12(10)11/h5-6,8-9,13H,3-4,7H2,1-2H3/b10-5+ |
| InChIKey | PCOKIPWVEATVPD-BJMVGYQFSA-N |
| XLogP | 3.08 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.34 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[(2E)-2-(4,5-dihydrocyclopenta[b]thiophen-6-ylidene)ethyl]propan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2E)-2-(4,5-dihydrocyclopenta[b]thiophen-6-ylidene)ethyl]propan-2-amine?
The IUPAC name of N-[(2E)-2-(4,5-dihydrocyclopenta[b]thiophen-6-ylidene)ethyl]propan-2-amine (CID 177187512) is N-[(2E)-2-(4,5-dihydrocyclopenta[b]thiophen-6-ylidene)ethyl]propan-2-amine.
What is the SMILES notation for N-[(2E)-2-(4,5-dihydrocyclopenta[b]thiophen-6-ylidene)ethyl]propan-2-amine?
The canonical SMILES for N-[(2E)-2-(4,5-dihydrocyclopenta[b]thiophen-6-ylidene)ethyl]propan-2-amine is CC(C)NC/C=C1\CCc2ccsc21.
What is the InChIKey of N-[(2E)-2-(4,5-dihydrocyclopenta[b]thiophen-6-ylidene)ethyl]propan-2-amine?
The InChIKey is PCOKIPWVEATVPD-BJMVGYQFSA-N. The full InChI is InChI=1S/C12H17NS/c1-9(2)13-7-5-10-3-4-11-6-8-14-12(10)11/h5-6,8-9,13H,3-4,7H2,1-2H3/b10-5+.
What are the key properties of N-[(2E)-2-(4,5-dihydrocyclopenta[b]thiophen-6-ylidene)ethyl]propan-2-amine?
N-[(2E)-2-(4,5-dihydrocyclopenta[b]thiophen-6-ylidene)ethyl]propan-2-amine has a molecular weight of 207.34 g/mol, XLogP of 3.08, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2E)-2-(4,5-dihydrocyclopenta[b]thiophen-6-ylidene)ethyl]propan-2-amine is sourced from PubChem (CID 177187512), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).