C20H28ClN3O4 — CID 177188676
tert-butyl 4-[[6-chloro-3-[(2-oxopyrrolidin-3-yl)methyl]-2-pyridinyl]oxy]piperidine-1-carboxylate (PubChem CID 177188676) has the molecular formula C20H28ClN3O4 and a molecular weight of 409.91 g/mol. Its IUPAC name is tert-butyl 4-[[6-chloro-3-[(2-oxopyrrolidin-3-yl)methyl]-2-pyridinyl]oxy]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[6-chloro-3-[(2-oxopyrrolidin-3-yl)methyl]-2-pyridinyl]oxy]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 177188676 |
| Molecular Formula | C20H28ClN3O4 |
| Molecular Weight | 409.91 g/mol |
| Exact Mass | 409.18 |
| IUPAC Name | tert-butyl 4-[[6-chloro-3-[(2-oxopyrrolidin-3-yl)methyl]-2-pyridinyl]oxy]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(Oc2nc(Cl)ccc2CC2CCNC2=O)CC1 |
| InChI | InChI=1S/C20H28ClN3O4/c1-20(2,3)28-19(26)24-10-7-15(8-11-24)27-18-14(4-5-16(21)23-18)12-13-6-9-22-17(13)25/h4-5,13,15H,6-12H2,1-3H3,(H,22,25) |
| InChIKey | OSONTZLGOVVSSF-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.91 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|