C24H40N4 — CID 177188975
5-(2,2,4,4,5,5,8,8-octamethyl-6-phenylnonan-3-yl)-2H-tetrazole (PubChem CID 177188975) has the molecular formula C24H40N4 and a molecular weight of 384.61 g/mol. Its IUPAC name is 5-(2,2,4,4,5,5,8,8-octamethyl-6-phenylnonan-3-yl)-2H-tetrazole.
| Compound Name | 5-(2,2,4,4,5,5,8,8-octamethyl-6-phenylnonan-3-yl)-2H-tetrazole |
|---|---|
| PubChem CID | 177188975 |
| Molecular Formula | C24H40N4 |
| Molecular Weight | 384.61 g/mol |
| Exact Mass | 384.33 |
| IUPAC Name | 5-(2,2,4,4,5,5,8,8-octamethyl-6-phenylnonan-3-yl)-2H-tetrazole |
| SMILES | CC(C)(C)CC(c1ccccc1)C(C)(C)C(C)(C)C(c1nn[nH]n1)C(C)(C)C |
| InChI | InChI=1S/C24H40N4/c1-21(2,3)16-18(17-14-12-11-13-15-17)23(7,8)24(9,10)19(22(4,5)6)20-25-27-28-26-20/h11-15,18-19H,16H2,1-10H3,(H,25,26,27,28) |
| InChIKey | TZLFXGDLRJUUKX-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.61 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |