About 5-[(E)-2,3-dimethylbut-1-enyl]-1-methyltetrazole;ethane
5-[(E)-2,3-dimethylbut-1-enyl]-1-methyltetrazole;ethane (PubChem CID 177189543) has the molecular formula C10H20N4
and a molecular weight of 196.30 g/mol. Its IUPAC name is 5-[(E)-2,3-dimethylbut-1-enyl]-1-methyltetrazole;ethane.
Molecular Properties
| Compound Name | 5-[(E)-2,3-dimethylbut-1-enyl]-1-methyltetrazole;ethane |
| PubChem CID | 177189543 |
| Molecular Formula | C10H20N4 |
| Molecular Weight | 196.30 g/mol |
| Exact Mass | 196.17 |
| IUPAC Name | 5-[(E)-2,3-dimethylbut-1-enyl]-1-methyltetrazole;ethane |
| SMILES | C/C(=C\c1nnnn1C)C(C)C.CC |
| InChI | InChI=1S/C8H14N4.C2H6/c1-6(2)7(3)5-8-9-10-11-12(8)4;1-2/h5-6H,1-4H3;1-2H3/b7-5+; |
| InChIKey | QOTCPKBTBOGSFL-GZOLSCHFSA-N |
| XLogP | 2.30 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.30 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-[(E)-2,3-dimethylbut-1-enyl]-1-methyltetrazole;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(E)-2,3-dimethylbut-1-enyl]-1-methyltetrazole;ethane?
The IUPAC name of 5-[(E)-2,3-dimethylbut-1-enyl]-1-methyltetrazole;ethane (CID 177189543) is 5-[(E)-2,3-dimethylbut-1-enyl]-1-methyltetrazole;ethane.
What is the SMILES notation for 5-[(E)-2,3-dimethylbut-1-enyl]-1-methyltetrazole;ethane?
The canonical SMILES for 5-[(E)-2,3-dimethylbut-1-enyl]-1-methyltetrazole;ethane is C/C(=C\c1nnnn1C)C(C)C.CC.
What is the InChIKey of 5-[(E)-2,3-dimethylbut-1-enyl]-1-methyltetrazole;ethane?
The InChIKey is QOTCPKBTBOGSFL-GZOLSCHFSA-N. The full InChI is InChI=1S/C8H14N4.C2H6/c1-6(2)7(3)5-8-9-10-11-12(8)4;1-2/h5-6H,1-4H3;1-2H3/b7-5+;.
What are the key properties of 5-[(E)-2,3-dimethylbut-1-enyl]-1-methyltetrazole;ethane?
5-[(E)-2,3-dimethylbut-1-enyl]-1-methyltetrazole;ethane has a molecular weight of 196.30 g/mol, XLogP of 2.30, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(E)-2,3-dimethylbut-1-enyl]-1-methyltetrazole;ethane is sourced from PubChem (CID 177189543), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).