C32H39ClFN3O3 — CID 177189947
(2E,4E)-4-[2-[4-[6-[(4-chloro-2-fluorophenyl)methoxy]-2-pyridinyl]piperidin-1-yl]ethyl-(oxetan-2-ylmethyl)amino]-2,5-dimethylhepta-2,4,6-trienal (PubChem CID 177189947) has the molecular formula C32H39ClFN3O3 and a molecular weight of 568.13 g/mol. Its IUPAC name is (2E,4E)-4-[2-[4-[6-[(4-chloro-2-fluorophenyl)methoxy]-2-pyridinyl]piperidin-1-yl]ethyl-(oxetan-2-ylmethyl)amino]-2,5-dimethylhepta-2,4,6-trienal.
| Compound Name | (2E,4E)-4-[2-[4-[6-[(4-chloro-2-fluorophenyl)methoxy]-2-pyridinyl]piperidin-1-yl]ethyl-(oxetan-2-ylmethyl)amino]-2,5-dimethylhepta-2,4,6-trienal |
|---|---|
| PubChem CID | 177189947 |
| Molecular Formula | C32H39ClFN3O3 |
| Molecular Weight | 568.13 g/mol |
| Exact Mass | 567.27 |
| IUPAC Name | (2E,4E)-4-[2-[4-[6-[(4-chloro-2-fluorophenyl)methoxy]-2-pyridinyl]piperidin-1-yl]ethyl-(oxetan-2-ylmethyl)amino]-2,5-dimethylhepta-2,4,6-trienal |
| SMILES | C=C/C(C)=C(\C=C(/C)C=O)N(CCN1CCC(c2cccc(OCc3ccc(Cl)cc3F)n2)CC1)CC1CCO1 |
| InChI | InChI=1S/C32H39ClFN3O3/c1-4-24(3)31(18-23(2)21-38)37(20-28-12-17-39-28)16-15-36-13-10-25(11-14-36)30-6-5-7-32(35-30)40-22-26-8-9-27(33)19-29(26)34/h4-9,18-19,21,25,28H,1,10-17,20,22H2,2-3H3/b23-18+,31-24+ |
| InChIKey | VVNUEXUMOZBDLG-VQDNCRTPSA-N |
| XLogP | 6.33 |
| TPSA | 54.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.13 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|