About 1-methoxy-4-[(2-methylpropan-2-yl)oxy]-2-phenylbenzene;praseodymium
1-methoxy-4-[(2-methylpropan-2-yl)oxy]-2-phenylbenzene;praseodymium (PubChem CID 177190391) has the molecular formula C17H18O2Pr2-2
and a molecular weight of 536.15 g/mol. Its IUPAC name is 1-methoxy-4-[(2-methylpropan-2-yl)oxy]-2-phenylbenzene;praseodymium.
Molecular Properties
| Compound Name | 1-methoxy-4-[(2-methylpropan-2-yl)oxy]-2-phenylbenzene;praseodymium |
| PubChem CID | 177190391 |
| Molecular Formula | C17H18O2Pr2-2 |
| Molecular Weight | 536.15 g/mol |
| Exact Mass | 535.95 |
| IUPAC Name | 1-methoxy-4-[(2-methylpropan-2-yl)oxy]-2-phenylbenzene;praseodymium |
| SMILES | COc1ccc(OC(C)(C)C)cc1-c1[c-]ccc[c-]1.[Pr].[Pr] |
| InChI | InChI=1S/C17H18O2.2Pr/c1-17(2,3)19-14-10-11-16(18-4)15(12-14)13-8-6-5-7-9-13;;/h5-7,10-12H,1-4H3;;/q-2;; |
| InChIKey | AJOSSTLLAIZFTJ-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 536.15 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 1-methoxy-4-[(2-methylpropan-2-yl)oxy]-2-phenylbenzene;praseodymium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxy-4-[(2-methylpropan-2-yl)oxy]-2-phenylbenzene;praseodymium?
The IUPAC name of 1-methoxy-4-[(2-methylpropan-2-yl)oxy]-2-phenylbenzene;praseodymium (CID 177190391) is 1-methoxy-4-[(2-methylpropan-2-yl)oxy]-2-phenylbenzene;praseodymium.
What is the SMILES notation for 1-methoxy-4-[(2-methylpropan-2-yl)oxy]-2-phenylbenzene;praseodymium?
The canonical SMILES for 1-methoxy-4-[(2-methylpropan-2-yl)oxy]-2-phenylbenzene;praseodymium is COc1ccc(OC(C)(C)C)cc1-c1[c-]ccc[c-]1.[Pr].[Pr].
What is the InChIKey of 1-methoxy-4-[(2-methylpropan-2-yl)oxy]-2-phenylbenzene;praseodymium?
The InChIKey is AJOSSTLLAIZFTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18O2.2Pr/c1-17(2,3)19-14-10-11-16(18-4)15(12-14)13-8-6-5-7-9-13;;/h5-7,10-12H,1-4H3;;/q-2;;.
What are the key properties of 1-methoxy-4-[(2-methylpropan-2-yl)oxy]-2-phenylbenzene;praseodymium?
1-methoxy-4-[(2-methylpropan-2-yl)oxy]-2-phenylbenzene;praseodymium has a molecular weight of 536.15 g/mol, XLogP of 4.14, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxy-4-[(2-methylpropan-2-yl)oxy]-2-phenylbenzene;praseodymium is sourced from PubChem (CID 177190391), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).