About CID 177190459
CID 177190459 (PubChem CID 177190459) has the molecular formula C3H4F2Si
and a molecular weight of 106.15 g/mol.
Molecular Properties
| Compound Name | CID 177190459 |
| PubChem CID | 177190459 |
| Molecular Formula | C3H4F2Si |
| Molecular Weight | 106.15 g/mol |
| Exact Mass | 106.01 |
| IUPAC Name | — |
| SMILES | C[Si]C=C(F)F |
| InChI | InChI=1S/C3H4F2Si/c1-6-2-3(4)5/h2H,1H3 |
| InChIKey | BKKDLQIWUWZCJT-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 106.15 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 177190459 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 177190459?
The IUPAC name of CID 177190459 (CID 177190459) is not available.
What is the SMILES notation for CID 177190459?
The canonical SMILES for CID 177190459 is C[Si]C=C(F)F.
What is the InChIKey of CID 177190459?
The InChIKey is BKKDLQIWUWZCJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H4F2Si/c1-6-2-3(4)5/h2H,1H3.
What are the key properties of CID 177190459?
CID 177190459 has a molecular weight of 106.15 g/mol, XLogP of 1.48, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 177190459 is sourced from PubChem (CID 177190459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).