C31H31ClF2N2O3 — CID 177190506
(2S)-2-[4-(4-chlorophenyl)-9-[(3,4-difluorophenyl)methyl]-2-methyl-5,6,7,8-tetrahydropyrido[2,3-b]indol-3-yl]-2-[(2-methylpropan-2-yl)oxy]acetic acid (PubChem CID 177190506) has the molecular formula C31H31ClF2N2O3 and a molecular weight of 553.05 g/mol. Its IUPAC name is (2S)-2-[4-(4-chlorophenyl)-9-[(3,4-difluorophenyl)methyl]-2-methyl-5,6,7,8-tetrahydropyrido[2,3-b]indol-3-yl]-2-[(2-methylpropan-2-yl)oxy]acetic acid.
| Compound Name | (2S)-2-[4-(4-chlorophenyl)-9-[(3,4-difluorophenyl)methyl]-2-methyl-5,6,7,8-tetrahydropyrido[2,3-b]indol-3-yl]-2-[(2-methylpropan-2-yl)oxy]acetic acid |
|---|---|
| PubChem CID | 177190506 |
| Molecular Formula | C31H31ClF2N2O3 |
| Molecular Weight | 553.05 g/mol |
| Exact Mass | 552.20 |
| IUPAC Name | (2S)-2-[4-(4-chlorophenyl)-9-[(3,4-difluorophenyl)methyl]-2-methyl-5,6,7,8-tetrahydropyrido[2,3-b]indol-3-yl]-2-[(2-methylpropan-2-yl)oxy]acetic acid |
| SMILES | Cc1nc2c(c3c(n2Cc2ccc(F)c(F)c2)CCCC3)c(-c2ccc(Cl)cc2)c1[C@H](OC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C31H31ClF2N2O3/c1-17-25(28(30(37)38)39-31(2,3)4)26(19-10-12-20(32)13-11-19)27-21-7-5-6-8-24(21)36(29(27)35-17)16-18-9-14-22(33)23(34)15-18/h9-15,28H,5-8,16H2,1-4H3,(H,37,38)/t28-/m0/s1 |
| InChIKey | SDGAVHSGMACXRA-NDEPHWFRSA-N |
| XLogP | 7.81 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.05 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |