About lithium;N-[(2,4-difluorophenyl)methyl]-N-ethylethanamine;ethane
lithium;N-[(2,4-difluorophenyl)methyl]-N-ethylethanamine;ethane (PubChem CID 177191035) has the molecular formula C13H18F2LiN-2
and a molecular weight of 233.23 g/mol. Its IUPAC name is lithium;N-[(2,4-difluorophenyl)methyl]-N-ethylethanamine;ethane.
Molecular Properties
| Compound Name | lithium;N-[(2,4-difluorophenyl)methyl]-N-ethylethanamine;ethane |
| PubChem CID | 177191035 |
| Molecular Formula | C13H18F2LiN-2 |
| Molecular Weight | 233.23 g/mol |
| Exact Mass | 233.16 |
| IUPAC Name | lithium;N-[(2,4-difluorophenyl)methyl]-N-ethylethanamine;ethane |
| SMILES | [CH2-]C.[CH2-]CN(C[CH2-])Cc1ccc(F)cc1F.[Li+] |
| InChI | InChI=1S/C11H13F2N.C2H5.Li/c1-3-14(4-2)8-9-5-6-10(12)7-11(9)13;1-2;/h5-7H,1-4,8H2;1H2,2H3;/q-2;-1;+1 |
| InChIKey | YYSRKVNJLMWQHJ-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.23 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze lithium;N-[(2,4-difluorophenyl)methyl]-N-ethylethanamine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;N-[(2,4-difluorophenyl)methyl]-N-ethylethanamine;ethane?
The IUPAC name of lithium;N-[(2,4-difluorophenyl)methyl]-N-ethylethanamine;ethane (CID 177191035) is lithium;N-[(2,4-difluorophenyl)methyl]-N-ethylethanamine;ethane.
What is the SMILES notation for lithium;N-[(2,4-difluorophenyl)methyl]-N-ethylethanamine;ethane?
The canonical SMILES for lithium;N-[(2,4-difluorophenyl)methyl]-N-ethylethanamine;ethane is [CH2-]C.[CH2-]CN(C[CH2-])Cc1ccc(F)cc1F.[Li+].
What is the InChIKey of lithium;N-[(2,4-difluorophenyl)methyl]-N-ethylethanamine;ethane?
The InChIKey is YYSRKVNJLMWQHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13F2N.C2H5.Li/c1-3-14(4-2)8-9-5-6-10(12)7-11(9)13;1-2;/h5-7H,1-4,8H2;1H2,2H3;/q-2;-1;+1.
What are the key properties of lithium;N-[(2,4-difluorophenyl)methyl]-N-ethylethanamine;ethane?
lithium;N-[(2,4-difluorophenyl)methyl]-N-ethylethanamine;ethane has a molecular weight of 233.23 g/mol, XLogP of 0.28, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;N-[(2,4-difluorophenyl)methyl]-N-ethylethanamine;ethane is sourced from PubChem (CID 177191035), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).