About 2-[[2,3-difluoro-4-[(2-oxo-1-pyridinyl)methyl]phenyl]methyl]-1,3-oxazole-5-carboxylic acid
2-[[2,3-difluoro-4-[(2-oxo-1-pyridinyl)methyl]phenyl]methyl]-1,3-oxazole-5-carboxylic acid (PubChem CID 177191367) has the molecular formula C17H12F2N2O4
and a molecular weight of 346.29 g/mol. Its IUPAC name is 2-[[2,3-difluoro-4-[(2-oxo-1-pyridinyl)methyl]phenyl]methyl]-1,3-oxazole-5-carboxylic acid.
Molecular Properties
| Compound Name | 2-[[2,3-difluoro-4-[(2-oxo-1-pyridinyl)methyl]phenyl]methyl]-1,3-oxazole-5-carboxylic acid |
| PubChem CID | 177191367 |
| Molecular Formula | C17H12F2N2O4 |
| Molecular Weight | 346.29 g/mol |
| Exact Mass | 346.08 |
| IUPAC Name | 2-[[2,3-difluoro-4-[(2-oxo-1-pyridinyl)methyl]phenyl]methyl]-1,3-oxazole-5-carboxylic acid |
| SMILES | O=C(O)c1cnc(Cc2ccc(Cn3ccccc3=O)c(F)c2F)o1 |
| InChI | InChI=1S/C17H12F2N2O4/c18-15-10(7-13-20-8-12(25-13)17(23)24)4-5-11(16(15)19)9-21-6-2-1-3-14(21)22/h1-6,8H,7,9H2,(H,23,24) |
| InChIKey | IHRDWHYMMJITLX-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 85.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.29 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[[2,3-difluoro-4-[(2-oxo-1-pyridinyl)methyl]phenyl]methyl]-1,3-oxazole-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[2,3-difluoro-4-[(2-oxo-1-pyridinyl)methyl]phenyl]methyl]-1,3-oxazole-5-carboxylic acid?
The IUPAC name of 2-[[2,3-difluoro-4-[(2-oxo-1-pyridinyl)methyl]phenyl]methyl]-1,3-oxazole-5-carboxylic acid (CID 177191367) is 2-[[2,3-difluoro-4-[(2-oxo-1-pyridinyl)methyl]phenyl]methyl]-1,3-oxazole-5-carboxylic acid.
What is the SMILES notation for 2-[[2,3-difluoro-4-[(2-oxo-1-pyridinyl)methyl]phenyl]methyl]-1,3-oxazole-5-carboxylic acid?
The canonical SMILES for 2-[[2,3-difluoro-4-[(2-oxo-1-pyridinyl)methyl]phenyl]methyl]-1,3-oxazole-5-carboxylic acid is O=C(O)c1cnc(Cc2ccc(Cn3ccccc3=O)c(F)c2F)o1.
What is the InChIKey of 2-[[2,3-difluoro-4-[(2-oxo-1-pyridinyl)methyl]phenyl]methyl]-1,3-oxazole-5-carboxylic acid?
The InChIKey is IHRDWHYMMJITLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12F2N2O4/c18-15-10(7-13-20-8-12(25-13)17(23)24)4-5-11(16(15)19)9-21-6-2-1-3-14(21)22/h1-6,8H,7,9H2,(H,23,24).
What are the key properties of 2-[[2,3-difluoro-4-[(2-oxo-1-pyridinyl)methyl]phenyl]methyl]-1,3-oxazole-5-carboxylic acid?
2-[[2,3-difluoro-4-[(2-oxo-1-pyridinyl)methyl]phenyl]methyl]-1,3-oxazole-5-carboxylic acid has a molecular weight of 346.29 g/mol, XLogP of 2.45, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[2,3-difluoro-4-[(2-oxo-1-pyridinyl)methyl]phenyl]methyl]-1,3-oxazole-5-carboxylic acid is sourced from PubChem (CID 177191367), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).