C24H34N8O6 — CID 177191512
ethanimidoyl 3-[3-[2-[2-[2-(5-methyl-1,2-dihydrotriazol-3-yl)ethoxy]ethoxy]ethoxy]propanoylamino]-5-(5-methyl-1,3,4-oxadiazol-2-yl)benzenecarboximidate (PubChem CID 177191512) has the molecular formula C24H34N8O6 and a molecular weight of 530.59 g/mol. Its IUPAC name is ethanimidoyl 3-[3-[2-[2-[2-(5-methyl-1,2-dihydrotriazol-3-yl)ethoxy]ethoxy]ethoxy]propanoylamino]-5-(5-methyl-1,3,4-oxadiazol-2-yl)benzenecarboximidate.
| Compound Name | ethanimidoyl 3-[3-[2-[2-[2-(5-methyl-1,2-dihydrotriazol-3-yl)ethoxy]ethoxy]ethoxy]propanoylamino]-5-(5-methyl-1,3,4-oxadiazol-2-yl)benzenecarboximidate |
|---|---|
| PubChem CID | 177191512 |
| Molecular Formula | C24H34N8O6 |
| Molecular Weight | 530.59 g/mol |
| Exact Mass | 530.26 |
| IUPAC Name | ethanimidoyl 3-[3-[2-[2-[2-(5-methyl-1,2-dihydrotriazol-3-yl)ethoxy]ethoxy]ethoxy]propanoylamino]-5-(5-methyl-1,3,4-oxadiazol-2-yl)benzenecarboximidate |
| SMILES | [H]/N=C(\O/C(C)=N/[H])c1cc(NC(=O)CCOCCOCCOCCN2C=C(C)NN2)cc(-c2nnc(C)o2)c1 |
| InChI | InChI=1S/C24H34N8O6/c1-16-15-32(31-28-16)5-7-35-9-11-36-10-8-34-6-4-22(33)27-21-13-19(23(26)37-17(2)25)12-20(14-21)24-30-29-18(3)38-24/h12-15,25-26,28,31H,4-11H2,1-3H3,(H,27,33)/b25-17+,26-23- |
| InChIKey | YZLMGGWGGZQXJB-SHDDXADGSA-N |
| XLogP | 1.95 |
| TPSA | 179.94 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.59 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|