About 2-chloro-1-[(3R)-4,4-difluoro-3-methylcyclohexyl]-4-fluorobenzene
2-chloro-1-[(3R)-4,4-difluoro-3-methylcyclohexyl]-4-fluorobenzene (PubChem CID 177192079) has the molecular formula C13H14ClF3
and a molecular weight of 262.70 g/mol. Its IUPAC name is 2-chloro-1-[(3R)-4,4-difluoro-3-methylcyclohexyl]-4-fluorobenzene.
Molecular Properties
| Compound Name | 2-chloro-1-[(3R)-4,4-difluoro-3-methylcyclohexyl]-4-fluorobenzene |
| PubChem CID | 177192079 |
| Molecular Formula | C13H14ClF3 |
| Molecular Weight | 262.70 g/mol |
| Exact Mass | 262.07 |
| IUPAC Name | 2-chloro-1-[(3R)-4,4-difluoro-3-methylcyclohexyl]-4-fluorobenzene |
| SMILES | C[C@@H]1CC(c2ccc(F)cc2Cl)CCC1(F)F |
| InChI | InChI=1S/C13H14ClF3/c1-8-6-9(4-5-13(8,16)17)11-3-2-10(15)7-12(11)14/h2-3,7-9H,4-6H2,1H3/t8-,9?/m1/s1 |
| InChIKey | MFHAKVSZSSJULR-VEDVMXKPSA-N |
| XLogP | 5.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 262.70 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2-chloro-1-[(3R)-4,4-difluoro-3-methylcyclohexyl]-4-fluorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-1-[(3R)-4,4-difluoro-3-methylcyclohexyl]-4-fluorobenzene?
The IUPAC name of 2-chloro-1-[(3R)-4,4-difluoro-3-methylcyclohexyl]-4-fluorobenzene (CID 177192079) is 2-chloro-1-[(3R)-4,4-difluoro-3-methylcyclohexyl]-4-fluorobenzene.
What is the SMILES notation for 2-chloro-1-[(3R)-4,4-difluoro-3-methylcyclohexyl]-4-fluorobenzene?
The canonical SMILES for 2-chloro-1-[(3R)-4,4-difluoro-3-methylcyclohexyl]-4-fluorobenzene is C[C@@H]1CC(c2ccc(F)cc2Cl)CCC1(F)F.
What is the InChIKey of 2-chloro-1-[(3R)-4,4-difluoro-3-methylcyclohexyl]-4-fluorobenzene?
The InChIKey is MFHAKVSZSSJULR-VEDVMXKPSA-N. The full InChI is InChI=1S/C13H14ClF3/c1-8-6-9(4-5-13(8,16)17)11-3-2-10(15)7-12(11)14/h2-3,7-9H,4-6H2,1H3/t8-,9?/m1/s1.
What are the key properties of 2-chloro-1-[(3R)-4,4-difluoro-3-methylcyclohexyl]-4-fluorobenzene?
2-chloro-1-[(3R)-4,4-difluoro-3-methylcyclohexyl]-4-fluorobenzene has a molecular weight of 262.70 g/mol, XLogP of 5.02, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-1-[(3R)-4,4-difluoro-3-methylcyclohexyl]-4-fluorobenzene is sourced from PubChem (CID 177192079), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).