C14H15ClF4 — CID 177192211
2-chloro-1-[(1R,3R)-3-ethyl-4,4-difluorocyclohexyl]-3,4-difluorobenzene (PubChem CID 177192211) has the molecular formula C14H15ClF4 and a molecular weight of 294.72 g/mol. Its IUPAC name is 2-chloro-1-[(1R,3R)-3-ethyl-4,4-difluorocyclohexyl]-3,4-difluorobenzene.
| Compound Name | 2-chloro-1-[(1R,3R)-3-ethyl-4,4-difluorocyclohexyl]-3,4-difluorobenzene |
|---|---|
| PubChem CID | 177192211 |
| Molecular Formula | C14H15ClF4 |
| Molecular Weight | 294.72 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | 2-chloro-1-[(1R,3R)-3-ethyl-4,4-difluorocyclohexyl]-3,4-difluorobenzene |
| SMILES | CC[C@@H]1C[C@H](c2ccc(F)c(F)c2Cl)CCC1(F)F |
| InChI | InChI=1S/C14H15ClF4/c1-2-9-7-8(5-6-14(9,18)19)10-3-4-11(16)13(17)12(10)15/h3-4,8-9H,2,5-7H2,1H3/t8-,9-/m1/s1 |
| InChIKey | QCGGPFJWIXSYOF-RKDXNWHRSA-N |
| XLogP | 5.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.72 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|