About 4,4-difluoro-1-(4-fluoro-2-methoxy-6-methylphenyl)piperidine;ethane;methanamine
4,4-difluoro-1-(4-fluoro-2-methoxy-6-methylphenyl)piperidine;ethane;methanamine (PubChem CID 177192241) has the molecular formula C16H27F3N2O
and a molecular weight of 320.40 g/mol. Its IUPAC name is 4,4-difluoro-1-(4-fluoro-2-methoxy-6-methylphenyl)piperidine;ethane;methanamine.
Molecular Properties
| Compound Name | 4,4-difluoro-1-(4-fluoro-2-methoxy-6-methylphenyl)piperidine;ethane;methanamine |
| PubChem CID | 177192241 |
| Molecular Formula | C16H27F3N2O |
| Molecular Weight | 320.40 g/mol |
| Exact Mass | 320.21 |
| IUPAC Name | 4,4-difluoro-1-(4-fluoro-2-methoxy-6-methylphenyl)piperidine;ethane;methanamine |
| SMILES | CC.CN.COc1cc(F)cc(C)c1N1CCC(F)(F)CC1 |
| InChI | InChI=1S/C13H16F3NO.C2H6.CH5N/c1-9-7-10(14)8-11(18-2)12(9)17-5-3-13(15,16)4-6-17;2*1-2/h7-8H,3-6H2,1-2H3;1-2H3;2H2,1H3 |
| InChIKey | CCCNIWJMKDUTJH-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.40 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4,4-difluoro-1-(4-fluoro-2-methoxy-6-methylphenyl)piperidine;ethane;methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4-difluoro-1-(4-fluoro-2-methoxy-6-methylphenyl)piperidine;ethane;methanamine?
The IUPAC name of 4,4-difluoro-1-(4-fluoro-2-methoxy-6-methylphenyl)piperidine;ethane;methanamine (CID 177192241) is 4,4-difluoro-1-(4-fluoro-2-methoxy-6-methylphenyl)piperidine;ethane;methanamine.
What is the SMILES notation for 4,4-difluoro-1-(4-fluoro-2-methoxy-6-methylphenyl)piperidine;ethane;methanamine?
The canonical SMILES for 4,4-difluoro-1-(4-fluoro-2-methoxy-6-methylphenyl)piperidine;ethane;methanamine is CC.CN.COc1cc(F)cc(C)c1N1CCC(F)(F)CC1.
What is the InChIKey of 4,4-difluoro-1-(4-fluoro-2-methoxy-6-methylphenyl)piperidine;ethane;methanamine?
The InChIKey is CCCNIWJMKDUTJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16F3NO.C2H6.CH5N/c1-9-7-10(14)8-11(18-2)12(9)17-5-3-13(15,16)4-6-17;2*1-2/h7-8H,3-6H2,1-2H3;1-2H3;2H2,1H3.
What are the key properties of 4,4-difluoro-1-(4-fluoro-2-methoxy-6-methylphenyl)piperidine;ethane;methanamine?
4,4-difluoro-1-(4-fluoro-2-methoxy-6-methylphenyl)piperidine;ethane;methanamine has a molecular weight of 320.40 g/mol, XLogP of 3.98, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-difluoro-1-(4-fluoro-2-methoxy-6-methylphenyl)piperidine;ethane;methanamine is sourced from PubChem (CID 177192241), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).