C23H24ClF2N3O2 — CID 177192269
1-chloro-2,3-difluorobenzene;2-(3-ethylcyclohexyl)-4-oxo-1H-1,6-naphthyridine-5-carboxamide (PubChem CID 177192269) has the molecular formula C23H24ClF2N3O2 and a molecular weight of 447.91 g/mol. Its IUPAC name is 1-chloro-2,3-difluorobenzene;2-(3-ethylcyclohexyl)-4-oxo-1H-1,6-naphthyridine-5-carboxamide.
| Compound Name | 1-chloro-2,3-difluorobenzene;2-(3-ethylcyclohexyl)-4-oxo-1H-1,6-naphthyridine-5-carboxamide |
|---|---|
| PubChem CID | 177192269 |
| Molecular Formula | C23H24ClF2N3O2 |
| Molecular Weight | 447.91 g/mol |
| Exact Mass | 447.15 |
| IUPAC Name | 1-chloro-2,3-difluorobenzene;2-(3-ethylcyclohexyl)-4-oxo-1H-1,6-naphthyridine-5-carboxamide |
| SMILES | CCC1CCCC(c2cc(=O)c3c(C(N)=O)nccc3[nH]2)C1.Fc1cccc(Cl)c1F |
| InChI | InChI=1S/C17H21N3O2.C6H3ClF2/c1-2-10-4-3-5-11(8-10)13-9-14(21)15-12(20-13)6-7-19-16(15)17(18)22;7-4-2-1-3-5(8)6(4)9/h6-7,9-11H,2-5,8H2,1H3,(H2,18,22)(H,20,21);1-3H |
| InChIKey | NMSONEXRKDGITG-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 88.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.91 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|