About CID 177194540
CID 177194540 (PubChem CID 177194540) has the molecular formula C8H11O2S
and a molecular weight of 171.24 g/mol.
Molecular Properties
| Compound Name | CID 177194540 |
| PubChem CID | 177194540 |
| Molecular Formula | C8H11O2S |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.05 |
| IUPAC Name | — |
| SMILES | COC(=O)CCC1=C[CH]SC1 |
| InChI | InChI=1S/C8H11O2S/c1-10-8(9)3-2-7-4-5-11-6-7/h4-5H,2-3,6H2,1H3 |
| InChIKey | RLRAPDRZDFNUGR-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze CID 177194540 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 177194540?
The IUPAC name of CID 177194540 (CID 177194540) is not available.
What is the SMILES notation for CID 177194540?
The canonical SMILES for CID 177194540 is COC(=O)CCC1=C[CH]SC1.
What is the InChIKey of CID 177194540?
The InChIKey is RLRAPDRZDFNUGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11O2S/c1-10-8(9)3-2-7-4-5-11-6-7/h4-5H,2-3,6H2,1H3.
What are the key properties of CID 177194540?
CID 177194540 has a molecular weight of 171.24 g/mol, XLogP of 1.77, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 177194540 is sourced from PubChem (CID 177194540), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).