C22H35IN4O — CID 177194679
4-[4-[(4,4-dimethylpiperidin-1-yl)methyl]cyclohexa-1,3-dien-1-yl]-9-iodo-1,4,9-triazaspiro[5.5]undecan-2-one (PubChem CID 177194679) has the molecular formula C22H35IN4O and a molecular weight of 498.45 g/mol. Its IUPAC name is 4-[4-[(4,4-dimethylpiperidin-1-yl)methyl]cyclohexa-1,3-dien-1-yl]-9-iodo-1,4,9-triazaspiro[5.5]undecan-2-one.
| Compound Name | 4-[4-[(4,4-dimethylpiperidin-1-yl)methyl]cyclohexa-1,3-dien-1-yl]-9-iodo-1,4,9-triazaspiro[5.5]undecan-2-one |
|---|---|
| PubChem CID | 177194679 |
| Molecular Formula | C22H35IN4O |
| Molecular Weight | 498.45 g/mol |
| Exact Mass | 498.19 |
| IUPAC Name | 4-[4-[(4,4-dimethylpiperidin-1-yl)methyl]cyclohexa-1,3-dien-1-yl]-9-iodo-1,4,9-triazaspiro[5.5]undecan-2-one |
| SMILES | CC1(C)CCN(CC2=CC=C(N3CC(=O)NC4(CCN(I)CC4)C3)CC2)CC1 |
| InChI | InChI=1S/C22H35IN4O/c1-21(2)7-11-25(12-8-21)15-18-3-5-19(6-4-18)26-16-20(28)24-22(17-26)9-13-27(23)14-10-22/h3,5H,4,6-17H2,1-2H3,(H,24,28) |
| InChIKey | LUJMHFQYKFAWRZ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.45 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|