C22H31F2N5O2 — CID 177194698
1-[[2,5-difluoro-4-(2-oxo-1,4,9-triazaspiro[5.5]undecan-4-yl)phenyl]methyl]-4-methylpiperidine-4-carboxamide (PubChem CID 177194698) has the molecular formula C22H31F2N5O2 and a molecular weight of 435.52 g/mol. Its IUPAC name is 1-[[2,5-difluoro-4-(2-oxo-1,4,9-triazaspiro[5.5]undecan-4-yl)phenyl]methyl]-4-methylpiperidine-4-carboxamide.
| Compound Name | 1-[[2,5-difluoro-4-(2-oxo-1,4,9-triazaspiro[5.5]undecan-4-yl)phenyl]methyl]-4-methylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 177194698 |
| Molecular Formula | C22H31F2N5O2 |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.24 |
| IUPAC Name | 1-[[2,5-difluoro-4-(2-oxo-1,4,9-triazaspiro[5.5]undecan-4-yl)phenyl]methyl]-4-methylpiperidine-4-carboxamide |
| SMILES | CC1(C(N)=O)CCN(Cc2cc(F)c(N3CC(=O)NC4(CCNCC4)C3)cc2F)CC1 |
| InChI | InChI=1S/C22H31F2N5O2/c1-21(20(25)31)4-8-28(9-5-21)12-15-10-17(24)18(11-16(15)23)29-13-19(30)27-22(14-29)2-6-26-7-3-22/h10-11,26H,2-9,12-14H2,1H3,(H2,25,31)(H,27,30) |
| InChIKey | UFPPYZQTXOXGGQ-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|