C19H32N3O9P — CID 177194990
[2,2-dimethylpropanoyloxymethoxy-[1-[[(3R)-3-hydroxyoxolan-2-yl]methyl]triazol-4-yl]phosphoryl]oxymethyl 2,2-dimethylpropanoate (PubChem CID 177194990) has the molecular formula C19H32N3O9P and a molecular weight of 477.45 g/mol. Its IUPAC name is [2,2-dimethylpropanoyloxymethoxy-[1-[[(3R)-3-hydroxyoxolan-2-yl]methyl]triazol-4-yl]phosphoryl]oxymethyl 2,2-dimethylpropanoate.
| Compound Name | [2,2-dimethylpropanoyloxymethoxy-[1-[[(3R)-3-hydroxyoxolan-2-yl]methyl]triazol-4-yl]phosphoryl]oxymethyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 177194990 |
| Molecular Formula | C19H32N3O9P |
| Molecular Weight | 477.45 g/mol |
| Exact Mass | 477.19 |
| IUPAC Name | [2,2-dimethylpropanoyloxymethoxy-[1-[[(3R)-3-hydroxyoxolan-2-yl]methyl]triazol-4-yl]phosphoryl]oxymethyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OCOP(=O)(OCOC(=O)C(C)(C)C)c1cn(CC2OCC[C@H]2O)nn1 |
| InChI | InChI=1S/C19H32N3O9P/c1-18(2,3)16(24)28-11-30-32(26,31-12-29-17(25)19(4,5)6)15-10-22(21-20-15)9-14-13(23)7-8-27-14/h10,13-14,23H,7-9,11-12H2,1-6H3/t13-,14?/m1/s1 |
| InChIKey | MQWWELXGNMPEKM-KWCCSABGSA-N |
| XLogP | 1.37 |
| TPSA | 148.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.45 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|