C17H11N3O5 — CID 177195350
2-[(6-acetyl-1,3-benzoxazol-2-yl)methoxy]-5-nitrobenzonitrile (PubChem CID 177195350) has the molecular formula C17H11N3O5 and a molecular weight of 337.29 g/mol. Its IUPAC name is 2-[(6-acetyl-1,3-benzoxazol-2-yl)methoxy]-5-nitrobenzonitrile.
| Compound Name | 2-[(6-acetyl-1,3-benzoxazol-2-yl)methoxy]-5-nitrobenzonitrile |
|---|---|
| PubChem CID | 177195350 |
| Molecular Formula | C17H11N3O5 |
| Molecular Weight | 337.29 g/mol |
| Exact Mass | 337.07 |
| IUPAC Name | 2-[(6-acetyl-1,3-benzoxazol-2-yl)methoxy]-5-nitrobenzonitrile |
| SMILES | CC(=O)c1ccc2nc(COc3ccc([N+](=O)[O-])cc3C#N)oc2c1 |
| InChI | InChI=1S/C17H11N3O5/c1-10(21)11-2-4-14-16(7-11)25-17(19-14)9-24-15-5-3-13(20(22)23)6-12(15)8-18/h2-7H,9H2,1H3 |
| InChIKey | MDTUKOLGDIIOPF-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 119.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.29 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|