C33H33N7O4S — CID 177195466
N-[(2,4-dimethoxyphenyl)methyl]-8-(3-methoxy-2,6-dimethylphenoxy)-6-(1-methylpyrazol-3-yl)-4-(5-methyl-1,3,4-thiadiazol-2-yl)-2,7-naphthyridin-1-amine (PubChem CID 177195466) has the molecular formula C33H33N7O4S and a molecular weight of 623.74 g/mol. Its IUPAC name is N-[(2,4-dimethoxyphenyl)methyl]-8-(3-methoxy-2,6-dimethylphenoxy)-6-(1-methylpyrazol-3-yl)-4-(5-methyl-1,3,4-thiadiazol-2-yl)-2,7-naphthyridin-1-amine.
| Compound Name | N-[(2,4-dimethoxyphenyl)methyl]-8-(3-methoxy-2,6-dimethylphenoxy)-6-(1-methylpyrazol-3-yl)-4-(5-methyl-1,3,4-thiadiazol-2-yl)-2,7-naphthyridin-1-amine |
|---|---|
| PubChem CID | 177195466 |
| Molecular Formula | C33H33N7O4S |
| Molecular Weight | 623.74 g/mol |
| Exact Mass | 623.23 |
| IUPAC Name | N-[(2,4-dimethoxyphenyl)methyl]-8-(3-methoxy-2,6-dimethylphenoxy)-6-(1-methylpyrazol-3-yl)-4-(5-methyl-1,3,4-thiadiazol-2-yl)-2,7-naphthyridin-1-amine |
| SMILES | COc1ccc(CNc2ncc(-c3nnc(C)s3)c3cc(-c4ccn(C)n4)nc(Oc4c(C)ccc(OC)c4C)c23)c(OC)c1 |
| InChI | InChI=1S/C33H33N7O4S/c1-18-8-11-27(42-6)19(2)30(18)44-32-29-23(15-26(36-32)25-12-13-40(4)39-25)24(33-38-37-20(3)45-33)17-35-31(29)34-16-21-9-10-22(41-5)14-28(21)43-7/h8-15,17H,16H2,1-7H3,(H,34,35) |
| InChIKey | KFIPSNVCJGPJNM-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 118.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.74 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |