C28H26ClFN6O4 — CID 177195603
7-chloro-N-[(2,4-dimethoxyphenyl)methyl]-5-[5-fluoro-1-(oxan-2-yl)indazol-4-yl]oxypyrido[4,3-d]pyrimidin-4-amine (PubChem CID 177195603) has the molecular formula C28H26ClFN6O4 and a molecular weight of 565.01 g/mol. Its IUPAC name is 7-chloro-N-[(2,4-dimethoxyphenyl)methyl]-5-[5-fluoro-1-(oxan-2-yl)indazol-4-yl]oxypyrido[4,3-d]pyrimidin-4-amine.
| Compound Name | 7-chloro-N-[(2,4-dimethoxyphenyl)methyl]-5-[5-fluoro-1-(oxan-2-yl)indazol-4-yl]oxypyrido[4,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 177195603 |
| Molecular Formula | C28H26ClFN6O4 |
| Molecular Weight | 565.01 g/mol |
| Exact Mass | 564.17 |
| IUPAC Name | 7-chloro-N-[(2,4-dimethoxyphenyl)methyl]-5-[5-fluoro-1-(oxan-2-yl)indazol-4-yl]oxypyrido[4,3-d]pyrimidin-4-amine |
| SMILES | COc1ccc(CNc2ncnc3cc(Cl)nc(Oc4c(F)ccc5c4cnn5C4CCCCO4)c23)c(OC)c1 |
| InChI | InChI=1S/C28H26ClFN6O4/c1-37-17-7-6-16(22(11-17)38-2)13-31-27-25-20(32-15-33-27)12-23(29)35-28(25)40-26-18-14-34-36(21(18)9-8-19(26)30)24-5-3-4-10-39-24/h6-9,11-12,14-15,24H,3-5,10,13H2,1-2H3,(H,31,32,33) |
| InChIKey | YPYBLYVRDBCHIW-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 105.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.01 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|