C34H32F2N8O4 — CID 177195661
7-N-(3,6-difluoro-2-pyridinyl)-4-N-[(2,4-dimethoxyphenyl)methyl]-5-[5-methyl-1-(oxan-2-yl)indazol-4-yl]oxypyrido[4,3-d]pyrimidine-4,7-diamine (PubChem CID 177195661) has the molecular formula C34H32F2N8O4 and a molecular weight of 654.68 g/mol. Its IUPAC name is 7-N-(3,6-difluoro-2-pyridinyl)-4-N-[(2,4-dimethoxyphenyl)methyl]-5-[5-methyl-1-(oxan-2-yl)indazol-4-yl]oxypyrido[4,3-d]pyrimidine-4,7-diamine.
| Compound Name | 7-N-(3,6-difluoro-2-pyridinyl)-4-N-[(2,4-dimethoxyphenyl)methyl]-5-[5-methyl-1-(oxan-2-yl)indazol-4-yl]oxypyrido[4,3-d]pyrimidine-4,7-diamine |
|---|---|
| PubChem CID | 177195661 |
| Molecular Formula | C34H32F2N8O4 |
| Molecular Weight | 654.68 g/mol |
| Exact Mass | 654.25 |
| IUPAC Name | 7-N-(3,6-difluoro-2-pyridinyl)-4-N-[(2,4-dimethoxyphenyl)methyl]-5-[5-methyl-1-(oxan-2-yl)indazol-4-yl]oxypyrido[4,3-d]pyrimidine-4,7-diamine |
| SMILES | COc1ccc(CNc2ncnc3cc(Nc4nc(F)ccc4F)nc(Oc4c(C)ccc5c4cnn5C4CCCCO4)c23)c(OC)c1 |
| InChI | InChI=1S/C34H32F2N8O4/c1-19-7-11-25-22(17-40-44(25)29-6-4-5-13-47-29)31(19)48-34-30-24(15-28(43-34)42-32-23(35)10-12-27(36)41-32)38-18-39-33(30)37-16-20-8-9-21(45-2)14-26(20)46-3/h7-12,14-15,17-18,29H,4-6,13,16H2,1-3H3,(H,37,38,39)(H,41,42,43) |
| InChIKey | LJOILCOBKUYZTB-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 130.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.68 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|