C31H36FNO4Si — CID 177196004
3-[ditert-butyl(fluoro)silyl]-5-[(9H-fluoren-9-ylmethoxycarbonylamino)methyl]benzoic acid (PubChem CID 177196004) has the molecular formula C31H36FNO4Si and a molecular weight of 533.72 g/mol. Its IUPAC name is 3-[ditert-butyl(fluoro)silyl]-5-[(9H-fluoren-9-ylmethoxycarbonylamino)methyl]benzoic acid.
| Compound Name | 3-[ditert-butyl(fluoro)silyl]-5-[(9H-fluoren-9-ylmethoxycarbonylamino)methyl]benzoic acid |
|---|---|
| PubChem CID | 177196004 |
| Molecular Formula | C31H36FNO4Si |
| Molecular Weight | 533.72 g/mol |
| Exact Mass | 533.24 |
| IUPAC Name | 3-[ditert-butyl(fluoro)silyl]-5-[(9H-fluoren-9-ylmethoxycarbonylamino)methyl]benzoic acid |
| SMILES | CC(C)(C)[Si](F)(c1cc(CNC(=O)OCC2c3ccccc3-c3ccccc32)cc(C(=O)O)c1)C(C)(C)C |
| InChI | InChI=1S/C31H36FNO4Si/c1-30(2,3)38(32,31(4,5)6)22-16-20(15-21(17-22)28(34)35)18-33-29(36)37-19-27-25-13-9-7-11-23(25)24-12-8-10-14-26(24)27/h7-17,27H,18-19H2,1-6H3,(H,33,36)(H,34,35) |
| InChIKey | KFBMGMIQEBLSNR-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.72 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|