C34H48N6O7 — CID 177196008
2-[[2-[[2-(2-aminobutanoylamino)-3-(4-hydroxyphenyl)propanoyl]amino]-4-phenylpent-4-enoyl]amino]-N-(1-amino-3-hydroxy-1-oxobutan-2-yl)hexanamide (PubChem CID 177196008) has the molecular formula C34H48N6O7 and a molecular weight of 652.79 g/mol. Its IUPAC name is 2-[[2-[[2-(2-aminobutanoylamino)-3-(4-hydroxyphenyl)propanoyl]amino]-4-phenylpent-4-enoyl]amino]-N-(1-amino-3-hydroxy-1-oxobutan-2-yl)hexanamide.
| Compound Name | 2-[[2-[[2-(2-aminobutanoylamino)-3-(4-hydroxyphenyl)propanoyl]amino]-4-phenylpent-4-enoyl]amino]-N-(1-amino-3-hydroxy-1-oxobutan-2-yl)hexanamide |
|---|---|
| PubChem CID | 177196008 |
| Molecular Formula | C34H48N6O7 |
| Molecular Weight | 652.79 g/mol |
| Exact Mass | 652.36 |
| IUPAC Name | 2-[[2-[[2-(2-aminobutanoylamino)-3-(4-hydroxyphenyl)propanoyl]amino]-4-phenylpent-4-enoyl]amino]-N-(1-amino-3-hydroxy-1-oxobutan-2-yl)hexanamide |
| SMILES | C=C(CC(NC(=O)C(Cc1ccc(O)cc1)NC(=O)C(N)CC)C(=O)NC(CCCC)C(=O)NC(C(N)=O)C(C)O)c1ccccc1 |
| InChI | InChI=1S/C34H48N6O7/c1-5-7-13-26(32(45)40-29(21(4)41)30(36)43)37-33(46)27(18-20(3)23-11-9-8-10-12-23)39-34(47)28(38-31(44)25(35)6-2)19-22-14-16-24(42)17-15-22/h8-12,14-17,21,25-29,41-42H,3,5-7,13,18-19,35H2,1-2,4H3,(H2,36,43)(H,37,46)(H,38,44)(H,39,47)(H,40,45) |
| InChIKey | RLKPTNWUUWIYAK-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 225.97 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.79 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |