About methyl 6-(3,6-dihydro-2H-pyran-4-yl)pyrazine-2-carboxylate
methyl 6-(3,6-dihydro-2H-pyran-4-yl)pyrazine-2-carboxylate (PubChem CID 177196857) has the molecular formula C11H12N2O3
and a molecular weight of 220.23 g/mol. Its IUPAC name is methyl 6-(3,6-dihydro-2H-pyran-4-yl)pyrazine-2-carboxylate.
Molecular Properties
| Compound Name | methyl 6-(3,6-dihydro-2H-pyran-4-yl)pyrazine-2-carboxylate |
| PubChem CID | 177196857 |
| Molecular Formula | C11H12N2O3 |
| Molecular Weight | 220.23 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | methyl 6-(3,6-dihydro-2H-pyran-4-yl)pyrazine-2-carboxylate |
| SMILES | COC(=O)c1cncc(C2=CCOCC2)n1 |
| InChI | InChI=1S/C11H12N2O3/c1-15-11(14)10-7-12-6-9(13-10)8-2-4-16-5-3-8/h2,6-7H,3-5H2,1H3 |
| InChIKey | ABSMOVRTWYEDGX-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.23 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 6-(3,6-dihydro-2H-pyran-4-yl)pyrazine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 6-(3,6-dihydro-2H-pyran-4-yl)pyrazine-2-carboxylate?
The IUPAC name of methyl 6-(3,6-dihydro-2H-pyran-4-yl)pyrazine-2-carboxylate (CID 177196857) is methyl 6-(3,6-dihydro-2H-pyran-4-yl)pyrazine-2-carboxylate.
What is the SMILES notation for methyl 6-(3,6-dihydro-2H-pyran-4-yl)pyrazine-2-carboxylate?
The canonical SMILES for methyl 6-(3,6-dihydro-2H-pyran-4-yl)pyrazine-2-carboxylate is COC(=O)c1cncc(C2=CCOCC2)n1.
What is the InChIKey of methyl 6-(3,6-dihydro-2H-pyran-4-yl)pyrazine-2-carboxylate?
The InChIKey is ABSMOVRTWYEDGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2O3/c1-15-11(14)10-7-12-6-9(13-10)8-2-4-16-5-3-8/h2,6-7H,3-5H2,1H3.
What are the key properties of methyl 6-(3,6-dihydro-2H-pyran-4-yl)pyrazine-2-carboxylate?
methyl 6-(3,6-dihydro-2H-pyran-4-yl)pyrazine-2-carboxylate has a molecular weight of 220.23 g/mol, XLogP of 1.07, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-(3,6-dihydro-2H-pyran-4-yl)pyrazine-2-carboxylate is sourced from PubChem (CID 177196857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).