C11H13NO4 — CID 177196861
methyl 5-[(3R)-oxolan-3-yl]oxypyridine-3-carboxylate (PubChem CID 177196861) has the molecular formula C11H13NO4 and a molecular weight of 223.23 g/mol. Its IUPAC name is methyl 5-[(3R)-oxolan-3-yl]oxypyridine-3-carboxylate.
| Compound Name | methyl 5-[(3R)-oxolan-3-yl]oxypyridine-3-carboxylate |
|---|---|
| PubChem CID | 177196861 |
| Molecular Formula | C11H13NO4 |
| Molecular Weight | 223.23 g/mol |
| Exact Mass | 223.08 |
| IUPAC Name | methyl 5-[(3R)-oxolan-3-yl]oxypyridine-3-carboxylate |
| SMILES | COC(=O)c1cncc(O[C@@H]2CCOC2)c1 |
| InChI | InChI=1S/C11H13NO4/c1-14-11(13)8-4-10(6-12-5-8)16-9-2-3-15-7-9/h4-6,9H,2-3,7H2,1H3/t9-/m1/s1 |
| InChIKey | PVKCXTJGPNPNHJ-SECBINFHSA-N |
| XLogP | 1.04 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.23 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |