C28H36N4O5S — CID 177197204
N-[(6aR)-6,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzoxazin-4-yl]-2-(6-azaspiro[2.5]octan-6-yl)-4-(2-hydroxyethylsulfonylamino)benzamide (PubChem CID 177197204) has the molecular formula C28H36N4O5S and a molecular weight of 540.69 g/mol. Its IUPAC name is N-[(6aR)-6,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzoxazin-4-yl]-2-(6-azaspiro[2.5]octan-6-yl)-4-(2-hydroxyethylsulfonylamino)benzamide.
| Compound Name | N-[(6aR)-6,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzoxazin-4-yl]-2-(6-azaspiro[2.5]octan-6-yl)-4-(2-hydroxyethylsulfonylamino)benzamide |
|---|---|
| PubChem CID | 177197204 |
| Molecular Formula | C28H36N4O5S |
| Molecular Weight | 540.69 g/mol |
| Exact Mass | 540.24 |
| IUPAC Name | N-[(6aR)-6,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzoxazin-4-yl]-2-(6-azaspiro[2.5]octan-6-yl)-4-(2-hydroxyethylsulfonylamino)benzamide |
| SMILES | O=C(Nc1cccc2c1OC[C@H]1CCCCN21)c1ccc(NS(=O)(=O)CCO)cc1N1CCC2(CC1)CC2 |
| InChI | InChI=1S/C28H36N4O5S/c33-16-17-38(35,36)30-20-7-8-22(25(18-20)31-14-11-28(9-10-28)12-15-31)27(34)29-23-5-3-6-24-26(23)37-19-21-4-1-2-13-32(21)24/h3,5-8,18,21,30,33H,1-2,4,9-17,19H2,(H,29,34)/t21-/m1/s1 |
| InChIKey | RREDBHCSWIETLE-OAQYLSRUSA-N |
| XLogP | 3.80 |
| TPSA | 111.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.69 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |