C12H14BrIN2O3 — CID 177197850
tert-butyl 7-bromo-8-iodo-2,3-dihydropyrido[2,3-b][1,4]oxazine-1-carboxylate (PubChem CID 177197850) has the molecular formula C12H14BrIN2O3 and a molecular weight of 441.06 g/mol. Its IUPAC name is tert-butyl 7-bromo-8-iodo-2,3-dihydropyrido[2,3-b][1,4]oxazine-1-carboxylate.
| Compound Name | tert-butyl 7-bromo-8-iodo-2,3-dihydropyrido[2,3-b][1,4]oxazine-1-carboxylate |
|---|---|
| PubChem CID | 177197850 |
| Molecular Formula | C12H14BrIN2O3 |
| Molecular Weight | 441.06 g/mol |
| Exact Mass | 439.92 |
| IUPAC Name | tert-butyl 7-bromo-8-iodo-2,3-dihydropyrido[2,3-b][1,4]oxazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCOc2ncc(Br)c(I)c21 |
| InChI | InChI=1S/C12H14BrIN2O3/c1-12(2,3)19-11(17)16-4-5-18-10-9(16)8(14)7(13)6-15-10/h6H,4-5H2,1-3H3 |
| InChIKey | WXMOKYKZQHFGER-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.06 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|