About 1-[3-(dimethylaminosulfanyl)phenyl]-1-methyl-3-[5-(3-methylphenoxy)-1,3-thiazol-2-yl]urea
1-[3-(dimethylaminosulfanyl)phenyl]-1-methyl-3-[5-(3-methylphenoxy)-1,3-thiazol-2-yl]urea (PubChem CID 177198311) has the molecular formula C20H22N4O2S2
and a molecular weight of 414.56 g/mol. Its IUPAC name is 1-[3-(dimethylaminosulfanyl)phenyl]-1-methyl-3-[5-(3-methylphenoxy)-1,3-thiazol-2-yl]urea.
Molecular Properties
| Compound Name | 1-[3-(dimethylaminosulfanyl)phenyl]-1-methyl-3-[5-(3-methylphenoxy)-1,3-thiazol-2-yl]urea |
| PubChem CID | 177198311 |
| Molecular Formula | C20H22N4O2S2 |
| Molecular Weight | 414.56 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | 1-[3-(dimethylaminosulfanyl)phenyl]-1-methyl-3-[5-(3-methylphenoxy)-1,3-thiazol-2-yl]urea |
| SMILES | Cc1cccc(Oc2cnc(NC(=O)N(C)c3cccc(SN(C)C)c3)s2)c1 |
| InChI | InChI=1S/C20H22N4O2S2/c1-14-7-5-9-16(11-14)26-18-13-21-19(27-18)22-20(25)24(4)15-8-6-10-17(12-15)28-23(2)3/h5-13H,1-4H3,(H,21,22,25) |
| InChIKey | RCIKMVWCKPYPHU-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 414.56 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-[3-(dimethylaminosulfanyl)phenyl]-1-methyl-3-[5-(3-methylphenoxy)-1,3-thiazol-2-yl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-(dimethylaminosulfanyl)phenyl]-1-methyl-3-[5-(3-methylphenoxy)-1,3-thiazol-2-yl]urea?
The IUPAC name of 1-[3-(dimethylaminosulfanyl)phenyl]-1-methyl-3-[5-(3-methylphenoxy)-1,3-thiazol-2-yl]urea (CID 177198311) is 1-[3-(dimethylaminosulfanyl)phenyl]-1-methyl-3-[5-(3-methylphenoxy)-1,3-thiazol-2-yl]urea.
What is the SMILES notation for 1-[3-(dimethylaminosulfanyl)phenyl]-1-methyl-3-[5-(3-methylphenoxy)-1,3-thiazol-2-yl]urea?
The canonical SMILES for 1-[3-(dimethylaminosulfanyl)phenyl]-1-methyl-3-[5-(3-methylphenoxy)-1,3-thiazol-2-yl]urea is Cc1cccc(Oc2cnc(NC(=O)N(C)c3cccc(SN(C)C)c3)s2)c1.
What is the InChIKey of 1-[3-(dimethylaminosulfanyl)phenyl]-1-methyl-3-[5-(3-methylphenoxy)-1,3-thiazol-2-yl]urea?
The InChIKey is RCIKMVWCKPYPHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22N4O2S2/c1-14-7-5-9-16(11-14)26-18-13-21-19(27-18)22-20(25)24(4)15-8-6-10-17(12-15)28-23(2)3/h5-13H,1-4H3,(H,21,22,25).
What are the key properties of 1-[3-(dimethylaminosulfanyl)phenyl]-1-methyl-3-[5-(3-methylphenoxy)-1,3-thiazol-2-yl]urea?
1-[3-(dimethylaminosulfanyl)phenyl]-1-methyl-3-[5-(3-methylphenoxy)-1,3-thiazol-2-yl]urea has a molecular weight of 414.56 g/mol, XLogP of 5.48, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-(dimethylaminosulfanyl)phenyl]-1-methyl-3-[5-(3-methylphenoxy)-1,3-thiazol-2-yl]urea is sourced from PubChem (CID 177198311), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).