About 3-[5-(4-fluorophenoxy)-1,3-thiazol-2-yl]-1-methyl-1-(1,3-thiazol-2-yl)urea
3-[5-(4-fluorophenoxy)-1,3-thiazol-2-yl]-1-methyl-1-(1,3-thiazol-2-yl)urea (PubChem CID 177198466) has the molecular formula C14H11FN4O2S2
and a molecular weight of 350.40 g/mol. Its IUPAC name is 3-[5-(4-fluorophenoxy)-1,3-thiazol-2-yl]-1-methyl-1-(1,3-thiazol-2-yl)urea.
Molecular Properties
| Compound Name | 3-[5-(4-fluorophenoxy)-1,3-thiazol-2-yl]-1-methyl-1-(1,3-thiazol-2-yl)urea |
| PubChem CID | 177198466 |
| Molecular Formula | C14H11FN4O2S2 |
| Molecular Weight | 350.40 g/mol |
| Exact Mass | 350.03 |
| IUPAC Name | 3-[5-(4-fluorophenoxy)-1,3-thiazol-2-yl]-1-methyl-1-(1,3-thiazol-2-yl)urea |
| SMILES | CN(C(=O)Nc1ncc(Oc2ccc(F)cc2)s1)c1nccs1 |
| InChI | InChI=1S/C14H11FN4O2S2/c1-19(14-16-6-7-22-14)13(20)18-12-17-8-11(23-12)21-10-4-2-9(15)3-5-10/h2-8H,1H3,(H,17,18,20) |
| InChIKey | CJRFCJLQRWISQD-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.40 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[5-(4-fluorophenoxy)-1,3-thiazol-2-yl]-1-methyl-1-(1,3-thiazol-2-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[5-(4-fluorophenoxy)-1,3-thiazol-2-yl]-1-methyl-1-(1,3-thiazol-2-yl)urea?
The IUPAC name of 3-[5-(4-fluorophenoxy)-1,3-thiazol-2-yl]-1-methyl-1-(1,3-thiazol-2-yl)urea (CID 177198466) is 3-[5-(4-fluorophenoxy)-1,3-thiazol-2-yl]-1-methyl-1-(1,3-thiazol-2-yl)urea.
What is the SMILES notation for 3-[5-(4-fluorophenoxy)-1,3-thiazol-2-yl]-1-methyl-1-(1,3-thiazol-2-yl)urea?
The canonical SMILES for 3-[5-(4-fluorophenoxy)-1,3-thiazol-2-yl]-1-methyl-1-(1,3-thiazol-2-yl)urea is CN(C(=O)Nc1ncc(Oc2ccc(F)cc2)s1)c1nccs1.
What is the InChIKey of 3-[5-(4-fluorophenoxy)-1,3-thiazol-2-yl]-1-methyl-1-(1,3-thiazol-2-yl)urea?
The InChIKey is CJRFCJLQRWISQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11FN4O2S2/c1-19(14-16-6-7-22-14)13(20)18-12-17-8-11(23-12)21-10-4-2-9(15)3-5-10/h2-8H,1H3,(H,17,18,20).
What are the key properties of 3-[5-(4-fluorophenoxy)-1,3-thiazol-2-yl]-1-methyl-1-(1,3-thiazol-2-yl)urea?
3-[5-(4-fluorophenoxy)-1,3-thiazol-2-yl]-1-methyl-1-(1,3-thiazol-2-yl)urea has a molecular weight of 350.40 g/mol, XLogP of 4.20, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[5-(4-fluorophenoxy)-1,3-thiazol-2-yl]-1-methyl-1-(1,3-thiazol-2-yl)urea is sourced from PubChem (CID 177198466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).