About 1a,5,6,7b-tetrahydro-1H-cyclopropa[f]chromen-7-one
1a,5,6,7b-tetrahydro-1H-cyclopropa[f]chromen-7-one (PubChem CID 177198503) has the molecular formula C10H10O2
and a molecular weight of 162.19 g/mol. Its IUPAC name is 1a,5,6,7b-tetrahydro-1H-cyclopropa[f]chromen-7-one.
Molecular Properties
| Compound Name | 1a,5,6,7b-tetrahydro-1H-cyclopropa[f]chromen-7-one |
| PubChem CID | 177198503 |
| Molecular Formula | C10H10O2 |
| Molecular Weight | 162.19 g/mol |
| Exact Mass | 162.07 |
| IUPAC Name | 1a,5,6,7b-tetrahydro-1H-cyclopropa[f]chromen-7-one |
| SMILES | O=C1CCOC2=C1C1CC1C=C2 |
| InChI | InChI=1S/C10H10O2/c11-8-3-4-12-9-2-1-6-5-7(6)10(8)9/h1-2,6-7H,3-5H2 |
| InChIKey | SXYFETQHKQLAHC-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.19 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1a,5,6,7b-tetrahydro-1H-cyclopropa[f]chromen-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1a,5,6,7b-tetrahydro-1H-cyclopropa[f]chromen-7-one?
The IUPAC name of 1a,5,6,7b-tetrahydro-1H-cyclopropa[f]chromen-7-one (CID 177198503) is 1a,5,6,7b-tetrahydro-1H-cyclopropa[f]chromen-7-one.
What is the SMILES notation for 1a,5,6,7b-tetrahydro-1H-cyclopropa[f]chromen-7-one?
The canonical SMILES for 1a,5,6,7b-tetrahydro-1H-cyclopropa[f]chromen-7-one is O=C1CCOC2=C1C1CC1C=C2.
What is the InChIKey of 1a,5,6,7b-tetrahydro-1H-cyclopropa[f]chromen-7-one?
The InChIKey is SXYFETQHKQLAHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10O2/c11-8-3-4-12-9-2-1-6-5-7(6)10(8)9/h1-2,6-7H,3-5H2.
What are the key properties of 1a,5,6,7b-tetrahydro-1H-cyclopropa[f]chromen-7-one?
1a,5,6,7b-tetrahydro-1H-cyclopropa[f]chromen-7-one has a molecular weight of 162.19 g/mol, XLogP of 1.44, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1a,5,6,7b-tetrahydro-1H-cyclopropa[f]chromen-7-one is sourced from PubChem (CID 177198503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).