C16H15FN2OS — CID 177198706
5-(3-fluorophenoxy)-N-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-1,3-thiazol-2-amine (PubChem CID 177198706) has the molecular formula C16H15FN2OS and a molecular weight of 302.37 g/mol. Its IUPAC name is 5-(3-fluorophenoxy)-N-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-1,3-thiazol-2-amine.
| Compound Name | 5-(3-fluorophenoxy)-N-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 177198706 |
| Molecular Formula | C16H15FN2OS |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | 5-(3-fluorophenoxy)-N-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-1,3-thiazol-2-amine |
| SMILES | C=C/C=C(\C=C/C)Nc1ncc(Oc2cccc(F)c2)s1 |
| InChI | InChI=1S/C16H15FN2OS/c1-3-6-13(7-4-2)19-16-18-11-15(21-16)20-14-9-5-8-12(17)10-14/h3-11H,1H2,2H3,(H,18,19)/b7-4-,13-6+ |
| InChIKey | IQWUZVRTGGFRDQ-CTIXMVKPSA-N |
| XLogP | 5.13 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|