C21H31BrN6S — CID 177199134
7-bromo-13-(3,8-diazabicyclo[3.2.1]octan-3-yl)-11-ethylsulfanyl-5,6,10,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7,10,12-hexaene;ethane (PubChem CID 177199134) has the molecular formula C21H31BrN6S and a molecular weight of 479.49 g/mol. Its IUPAC name is 7-bromo-13-(3,8-diazabicyclo[3.2.1]octan-3-yl)-11-ethylsulfanyl-5,6,10,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7,10,12-hexaene;ethane.
| Compound Name | 7-bromo-13-(3,8-diazabicyclo[3.2.1]octan-3-yl)-11-ethylsulfanyl-5,6,10,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7,10,12-hexaene;ethane |
|---|---|
| PubChem CID | 177199134 |
| Molecular Formula | C21H31BrN6S |
| Molecular Weight | 479.49 g/mol |
| Exact Mass | 478.15 |
| IUPAC Name | 7-bromo-13-(3,8-diazabicyclo[3.2.1]octan-3-yl)-11-ethylsulfanyl-5,6,10,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7,10,12-hexaene;ethane |
| SMILES | CC.CC.CCSc1nc(N2CC3CCC(C2)N3)c2c(cc(Br)n3nccc23)n1 |
| InChI | InChI=1S/C17H19BrN6S.2C2H6/c1-2-25-17-21-12-7-14(18)24-13(5-6-19-24)15(12)16(22-17)23-8-10-3-4-11(9-23)20-10;2*1-2/h5-7,10-11,20H,2-4,8-9H2,1H3;2*1-2H3 |
| InChIKey | AIMKYYLQKLJJQS-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 58.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.49 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|