About (5-methyloxan-3-yl) hypofluorite
(5-methyloxan-3-yl) hypofluorite (PubChem CID 177199357) has the molecular formula C6H11FO2
and a molecular weight of 134.15 g/mol. Its IUPAC name is (5-methyloxan-3-yl) hypofluorite.
Molecular Properties
| Compound Name | (5-methyloxan-3-yl) hypofluorite |
| PubChem CID | 177199357 |
| Molecular Formula | C6H11FO2 |
| Molecular Weight | 134.15 g/mol |
| Exact Mass | 134.07 |
| IUPAC Name | (5-methyloxan-3-yl) hypofluorite |
| SMILES | CC1COCC(OF)C1 |
| InChI | InChI=1S/C6H11FO2/c1-5-2-6(9-7)4-8-3-5/h5-6H,2-4H2,1H3 |
| InChIKey | AARAXFSFGFVFHG-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.15 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (5-methyloxan-3-yl) hypofluorite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-methyloxan-3-yl) hypofluorite?
The IUPAC name of (5-methyloxan-3-yl) hypofluorite (CID 177199357) is (5-methyloxan-3-yl) hypofluorite.
What is the SMILES notation for (5-methyloxan-3-yl) hypofluorite?
The canonical SMILES for (5-methyloxan-3-yl) hypofluorite is CC1COCC(OF)C1.
What is the InChIKey of (5-methyloxan-3-yl) hypofluorite?
The InChIKey is AARAXFSFGFVFHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11FO2/c1-5-2-6(9-7)4-8-3-5/h5-6H,2-4H2,1H3.
What are the key properties of (5-methyloxan-3-yl) hypofluorite?
(5-methyloxan-3-yl) hypofluorite has a molecular weight of 134.15 g/mol, XLogP of 1.31, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5-methyloxan-3-yl) hypofluorite is sourced from PubChem (CID 177199357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).