C23H28FN7O4 — CID 177200304
5-[[1-[(3R,4R)-3-fluoropiperidin-4-yl]-2-oxo-3-pyridinyl]amino]-N-[(1R,2R)-2-methoxycyclobutyl]-7-(methylamino)-[1,2]oxazolo[4,3-b]pyridine-3-carboxamide (PubChem CID 177200304) has the molecular formula C23H28FN7O4 and a molecular weight of 485.52 g/mol. Its IUPAC name is 5-[[1-[(3R,4R)-3-fluoropiperidin-4-yl]-2-oxo-3-pyridinyl]amino]-N-[(1R,2R)-2-methoxycyclobutyl]-7-(methylamino)-[1,2]oxazolo[4,3-b]pyridine-3-carboxamide.
| Compound Name | 5-[[1-[(3R,4R)-3-fluoropiperidin-4-yl]-2-oxo-3-pyridinyl]amino]-N-[(1R,2R)-2-methoxycyclobutyl]-7-(methylamino)-[1,2]oxazolo[4,3-b]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 177200304 |
| Molecular Formula | C23H28FN7O4 |
| Molecular Weight | 485.52 g/mol |
| Exact Mass | 485.22 |
| IUPAC Name | 5-[[1-[(3R,4R)-3-fluoropiperidin-4-yl]-2-oxo-3-pyridinyl]amino]-N-[(1R,2R)-2-methoxycyclobutyl]-7-(methylamino)-[1,2]oxazolo[4,3-b]pyridine-3-carboxamide |
| SMILES | CNc1cc(Nc2cccn([C@@H]3CCNC[C@H]3F)c2=O)nc2c(C(=O)N[C@@H]3CC[C@H]3OC)onc12 |
| InChI | InChI=1S/C23H28FN7O4/c1-25-15-10-18(27-14-4-3-9-31(23(14)33)16-7-8-26-11-12(16)24)29-20-19(15)30-35-21(20)22(32)28-13-5-6-17(13)34-2/h3-4,9-10,12-13,16-17,25-26H,5-8,11H2,1-2H3,(H,27,29)(H,28,32)/t12-,13-,16-,17-/m1/s1 |
| InChIKey | WLPIHYIXLLLBHB-BQGCOEIASA-N |
| XLogP | 1.95 |
| TPSA | 135.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.52 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |