About [(3S,4R)-3-fluoropiperidin-4-yl] 2-oxo-1H-pyridine-3-carboxylate
[(3S,4R)-3-fluoropiperidin-4-yl] 2-oxo-1H-pyridine-3-carboxylate (PubChem CID 177200376) has the molecular formula C11H13FN2O3
and a molecular weight of 240.23 g/mol. Its IUPAC name is [(3S,4R)-3-fluoropiperidin-4-yl] 2-oxo-1H-pyridine-3-carboxylate.
Molecular Properties
| Compound Name | [(3S,4R)-3-fluoropiperidin-4-yl] 2-oxo-1H-pyridine-3-carboxylate |
| PubChem CID | 177200376 |
| Molecular Formula | C11H13FN2O3 |
| Molecular Weight | 240.23 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | [(3S,4R)-3-fluoropiperidin-4-yl] 2-oxo-1H-pyridine-3-carboxylate |
| SMILES | O=C(O[C@@H]1CCNC[C@@H]1F)c1ccc[nH]c1=O |
| InChI | InChI=1S/C11H13FN2O3/c12-8-6-13-5-3-9(8)17-11(16)7-2-1-4-14-10(7)15/h1-2,4,8-9,13H,3,5-6H2,(H,14,15)/t8-,9+/m0/s1 |
| InChIKey | DAVBKKLXNSUBHT-DTWKUNHWSA-N |
| XLogP | 0.23 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.23 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(3S,4R)-3-fluoropiperidin-4-yl] 2-oxo-1H-pyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3S,4R)-3-fluoropiperidin-4-yl] 2-oxo-1H-pyridine-3-carboxylate?
The IUPAC name of [(3S,4R)-3-fluoropiperidin-4-yl] 2-oxo-1H-pyridine-3-carboxylate (CID 177200376) is [(3S,4R)-3-fluoropiperidin-4-yl] 2-oxo-1H-pyridine-3-carboxylate.
What is the SMILES notation for [(3S,4R)-3-fluoropiperidin-4-yl] 2-oxo-1H-pyridine-3-carboxylate?
The canonical SMILES for [(3S,4R)-3-fluoropiperidin-4-yl] 2-oxo-1H-pyridine-3-carboxylate is O=C(O[C@@H]1CCNC[C@@H]1F)c1ccc[nH]c1=O.
What is the InChIKey of [(3S,4R)-3-fluoropiperidin-4-yl] 2-oxo-1H-pyridine-3-carboxylate?
The InChIKey is DAVBKKLXNSUBHT-DTWKUNHWSA-N. The full InChI is InChI=1S/C11H13FN2O3/c12-8-6-13-5-3-9(8)17-11(16)7-2-1-4-14-10(7)15/h1-2,4,8-9,13H,3,5-6H2,(H,14,15)/t8-,9+/m0/s1.
What are the key properties of [(3S,4R)-3-fluoropiperidin-4-yl] 2-oxo-1H-pyridine-3-carboxylate?
[(3S,4R)-3-fluoropiperidin-4-yl] 2-oxo-1H-pyridine-3-carboxylate has a molecular weight of 240.23 g/mol, XLogP of 0.23, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(3S,4R)-3-fluoropiperidin-4-yl] 2-oxo-1H-pyridine-3-carboxylate is sourced from PubChem (CID 177200376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).